CAS 32846-66-5
:pentacyclo[4.2.0.0~2,5~.0~3,8~.0~4,7~]octane-1,4-dicarboxylic acid
Description:
Pentacyclo[4.2.0.0^2,5.0^3,8.0^4,7]octane-1,4-dicarboxylic acid is a polycyclic compound characterized by its unique fused ring structure, which consists of five interconnected cycloalkane rings. This compound features two carboxylic acid functional groups located at the 1 and 4 positions of the octane framework, contributing to its acidity and potential reactivity. The presence of these carboxylic groups enhances its solubility in polar solvents and allows for potential interactions in various chemical reactions, such as esterification or amidation. The rigid structure of pentacyclo[4.2.0.0^2,5.0^3,8.0^4,7]octane also imparts significant stability, making it less prone to conformational changes. This compound may exhibit interesting properties in materials science and organic synthesis due to its unique architecture. Additionally, its CAS number, 32846-66-5, allows for easy identification in chemical databases and literature. Overall, pentacyclo[4.2.0.0^2,5.0^3,8.0^4,7]octane-1,4-dicarboxylic acid is a notable compound with potential applications in various fields of chemistry.
Formula:C10H8O4
InChI:InChI=1/C10H8O4/c11-7(12)9-1-2-4(9)6-5(9)3(1)10(2,6)8(13)14/h1-6H,(H,11,12)(H,13,14)
SMILES:C12C3C4C5C(C1C35C(=O)O)C24C(=O)O
Synonyms:- Cubane-1,4-dicarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Pentacyclo[4.2.0.02,5.03,8.04,7]octane-1,4-dicarboxylicacid
CAS:Formula:C10H8O4Purity:98%Color and Shape:SolidMolecular weight:192.1681(1S,2R,3R,8S)-Cubane-1,4-dicarboxylic acid
CAS:(1S,2R,3R,8S)-Cubane-1,4-dicarboxylic acidFormula:C10H8O4Purity:97%Color and Shape: white solidMolecular weight:192.17g/mol1,4-Cubanedicarboxylic Acid
CAS:Controlled ProductApplications 1,4-Cubanedicarboxylic acid
Formula:C10H8O4Color and Shape:NeatMolecular weight:192.1681,4-Cubanedicarboxylic acid
CAS:1,4-Cubanedicarboxylic acid is an organic compound that is a diacid. It has been shown to be an inhibitor of chloride secretion in the intestine, and can also decrease the rate at which hydrogen ions are released into the intestinal lumen. 1,4-Cubanedicarboxylic acid is also a cross-linking agent that can be used in organic solvents for large-scale synthesis. The optical properties of 1,4-cubanedicarboxylic acid have been studied using FTIR spectroscopy. This agent has been found to react with intramolecular hydrogen to form a six membered ring.Formula:C10H8O4Purity:Min. 95%Molecular weight:192.17 g/mol





