
CAS 328526-86-9
:D-Histidine hydrochloride monohydrate
Description:
D-Histidine hydrochloride monohydrate is a chemical compound that serves as a derivative of the amino acid histidine, specifically in its D-enantiomer form. It is characterized by its white crystalline appearance and is soluble in water, which makes it useful in various biochemical applications. The presence of the hydrochloride indicates that it is a salt formed with hydrochloric acid, enhancing its solubility and stability in aqueous solutions. As a monohydrate, it contains one molecule of water for each molecule of the compound, which can influence its physical properties and stability. D-Histidine plays a role in various biological processes and is often utilized in research, particularly in studies related to protein synthesis and enzyme activity. Its unique stereochemistry distinguishes it from L-histidine, the naturally occurring form, and can affect its biological interactions and functions. Overall, D-Histidine hydrochloride monohydrate is a valuable compound in both pharmaceutical and biochemical research contexts.
Formula:C6H9N3O2·ClH·H2O
InChI:InChI=1S/C6H9N3O2.ClH.H2O/c7-5(6(10)11)1-4-2-8-3-9-4;;/h2-3,5H,1,7H2,(H,8,9)(H,10,11);1H;1H2/t5-;;/m1../s1
InChI key:InChIKey=CMXXUDSWGMGYLZ-ZJIMSODOSA-N
SMILES:C([C@H](C(O)=O)N)C1=CN=CN1.Cl.O
Synonyms:- D-Histidine hydrochloride monohydrate
- D-Histidine, monohydrochloride, monohydrate
- D-Histidine, hydrochloride, hydrate (1:1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
D-Histidine Hydrochloride Hydrate
CAS:Controlled Product<p>Stability Hygroscopic<br>Applications D-Histidine, Hydrochloride Monohydrate was a useful reagent for the preparation of diastereomeric histidine-containing dipeptides to analyze lipophilicity and ionization constants.<br>References Vistoli, G., et al.: Chirality, 24, 566 (2012)<br></p>Formula:C6H9N3O2·HCl·xH2OColor and Shape:NeatMolecular weight:155.16 + 36.46 + x(18.02)
