CAS 328541-79-3: N'-[(1E)-(3,5-dibromo-2,4-dihydroxyphenyl)methylidene]-2-(naphthalen-2-ylamino)acetohydrazide (non-preferred name)
Description:N'-[(1E)-(3,5-dibromo-2,4-dihydroxyphenyl)methylidene]-2-(naphthalen-2-ylamino)acetohydrazide, identified by its CAS number 328541-79-3, is a synthetic organic compound characterized by its complex structure, which includes multiple functional groups such as hydrazide, amine, and hydroxyl groups. This compound features a naphthalene moiety linked to an acetohydrazide, contributing to its potential biological activity. The presence of dibromo and dihydroxy substituents on the phenyl ring enhances its reactivity and may influence its solubility and stability in various solvents. The compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of bioactive functional groups. Additionally, the compound's unique arrangement may allow for interactions with biological targets, making it a candidate for further investigation in drug discovery and development. However, detailed studies on its pharmacological properties, toxicity, and environmental impact would be necessary to fully understand its potential applications and safety profile.
Formula:C19H15Br2N3O3
InChI:InChI=1/C19H15Br2N3O3/c20-15-8-13(18(26)17(21)19(15)27)9-23-24-16(25)10-22-14-6-5-11-3-1-2-4-12(11)7-14/h1-9,22,26-27H,10H2,(H,24,25)/b23-9+