CAS 328549-49-1

2-(4-methylpyridin-2-yl)-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid

Description:

2-(4-Methylpyridin-2-yl)-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid, with CAS number 328549-49-1, is a chemical compound characterized by its complex structure that includes an isoindole core and a pyridine ring. This compound features a dioxo functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the carboxylic acid group indicates that it can participate in acid-base reactions and may serve as a precursor for further chemical modifications. The methyl group on the pyridine ring can influence the compound's solubility and reactivity, making it of interest in medicinal chemistry and material science. Additionally, the compound's unique structure may exhibit specific biological activities, which could be explored for pharmaceutical applications. Its stability, solubility, and reactivity would depend on the surrounding conditions, such as pH and solvent type. Overall, this compound represents a valuable entity for research in various chemical fields.

Formula: C₁₅H₁₀N₂O₄

InChI: InChI=1/C15H10N2O4/c1-8-4-5-16-12(6-8)17-13(18)10-3-2-9(15(20)21)7-11(10)14(17)19/h2-7H,1H3,(H,20,21)

SMILES: Cc1ccnc(c1)N1C(=O)c2ccc(cc2C1=O)C(=O)O

Synonyms:

• 1H-Isoindole-5-carboxylic acid, 2,3-dihydro-2-(4-methyl-2-pyridinyl)-1,3-dioxo-
• 2-(4-Methylpyridin-2-yl)-1,3-dioxoisoindoline-5-carboxylic acid

2-(4-methylpyridin-2-yl)-1,3-dioxoisoindoline-5-carboxylic acid

CAS: 328549-49-1

Purity: 95.0%

Molecular weight: 282.2550048828125

Ref: 10-F314454