CAS 3286-01-9
:2,7-dimethyl-4a,9a-dihydroanthracene-9,10-dione
Description:
2,7-Dimethyl-4a,9a-dihydroanthracene-9,10-dione, with CAS number 3286-01-9, is an organic compound belonging to the class of anthraquinones. This substance features a polycyclic aromatic structure characterized by two methyl groups at the 2 and 7 positions, contributing to its unique chemical properties. The presence of the diketone functional groups at the 9 and 10 positions enhances its reactivity, making it useful in various chemical applications, including as a dye or pigment. The compound is typically solid at room temperature and exhibits a characteristic color, which can vary based on its concentration and the presence of other substances. Its solubility is generally moderate in organic solvents, while it may be less soluble in water. The compound's stability and reactivity can be influenced by environmental factors such as light and temperature. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if inhaled or ingested. Overall, 2,7-dimethyl-4a,9a-dihydroanthracene-9,10-dione is notable for its structural features and potential applications in organic synthesis and materials science.
Formula:C16H14O2
InChI:InChI=1/C16H14O2/c1-9-3-5-11-13(7-9)16(18)14-8-10(2)4-6-12(14)15(11)17/h3-8,11,13H,1-2H3
SMILES:CC1=CC2C(C=C1)C(=O)c1ccc(C)cc1C2=O
Synonyms:- 2,7-DIMETHYLANTHRAQUINONE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,7-Dimethylanthraquinone
CAS:Controlled ProductApplications 2,7-Dimethylanthraquinone (cas# 3286-01-9) is a compound useful in organic synthesis.
References Kuo, D., et al.: J. Pharm. Pharmacol., 52, 839 (2000), Zagotto, G., et al.: Bioorg. Med. Chem., 16, 354 (2008),Formula:C16H12O2Color and Shape:NeatMolecular weight:236.27
