CAS 32860-62-1: Maltotriitol
Description:Maltotriitol, with the CAS number 32860-62-1, is a carbohydrate derivative that belongs to the class of sugar alcohols. It is a trisaccharide composed of three glucose units linked by glycosidic bonds, specifically featuring a structure that includes multiple hydroxyl (-OH) groups, which contribute to its hydrophilic nature. Maltotriitol is typically characterized by its sweet taste, making it a potential candidate for use as a sugar substitute in food products. It is soluble in water, which enhances its applicability in various formulations. Additionally, maltotriitol is non-toxic and generally recognized as safe for consumption, which is advantageous for its use in dietary products. Its properties may also include low caloric content compared to traditional sugars, making it suitable for low-calorie and diabetic-friendly food options. Furthermore, maltotriitol can participate in various biochemical reactions, making it of interest in both food science and biochemistry. Overall, its unique structural features and functional properties make maltotriitol a valuable compound in the food industry and beyond.
Formula:C18H34O16
InChI:InChI=1S/C18H34O16/c19-1-5(23)9(25)15(6(24)2-20)33-18-14(30)12(28)16(8(4-22)32-18)34-17-13(29)11(27)10(26)7(3-21)31-17/h5-30H,1-4H2/t5-,6+,7+,8+,9+,10+,11-,12+,13+,14+,15+,16+,17+,18+/m0/s1
InChI key:InChIKey=XJCCHWKNFMUJFE-CGQAXDJHSA-N
SMILES:OCC(O)C(O)C(OC1OC(CO)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O)C(O)CO
- Synonyms:
- <span class="text-smallcaps">D</smallcap>-Glucitol, O-α-<smallcap>D</smallcap>-glucopyranosyl-(1→4)-O-α-<smallcap>D</span>-glucopyranosyl-(1→4)-
- Glucitol, O-α-<span class="text-smallcaps">D</smallcap>-glucopyranosyl-(1→4)-O-α-<smallcap>D</smallcap>-glucopyranosyl-(1→4)-, <smallcap>D</span>-
- O-alpha-D-Glucopyranosyl-(1.4)-O-alpha-D-glucopyranosyl-(1.4)-D-glucitol
- O-α-<span class="text-smallcaps">D</smallcap>-Glucopyranosyl-(1→4)-O-α-<smallcap>D</smallcap>-glucopyranosyl-(1→4)-<smallcap>D</span>-glucitol
- alpha-D-glucopyranosyl-(1->4)-(3xi)-alpha-D-ribo-hexopyranosyl-(1->4)-(4xi)-D-xylo-hexitol
- Glucitol, O-α-D-glucopyranosyl-(1→4)-O-α-D-glucopyranosyl-(1→4)-, D-
- O-α-D-Glucopyranosyl-(1→4)-O-α-D-glucopyranosyl-(1→4)-D-glucitol
- D-Glucitol, O-α-D-glucopyranosyl-(1→4)-O-α-D-glucopyranosyl-(1→4)-
- Maltotriitol
