CAS 32873-57-7
:5-(Acetylamino)-1,3,4-thiadiazole-2-sulfonyl chloride
Description:
5-(Acetylamino)-1,3,4-thiadiazole-2-sulfonyl chloride is a chemical compound characterized by its unique structure, which includes a thiadiazole ring, an acetylamino group, and a sulfonyl chloride functional group. This compound typically appears as a solid and is known for its reactivity due to the presence of the sulfonyl chloride moiety, which can participate in nucleophilic substitution reactions. It is often used in organic synthesis and medicinal chemistry as an intermediate for the preparation of various bioactive molecules. The presence of the acetylamino group enhances its solubility in polar solvents, making it suitable for various applications. Additionally, the thiadiazole ring contributes to its potential biological activity, as thiadiazoles are known to exhibit a range of pharmacological properties. Safety precautions should be taken when handling this compound, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or alcohols. Overall, 5-(Acetylamino)-1,3,4-thiadiazole-2-sulfonyl chloride is a versatile compound in chemical research and development.
Formula:C4H4ClN3O3S2
InChI:InChI=1S/C4H4ClN3O3S2/c1-2(9)6-3-7-8-4(12-3)13(5,10)11/h1H3,(H,6,7,9)
InChI key:InChIKey=MEJAPGGFIJZHEJ-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C=1SC(NC(C)=O)=NN1
Synonyms:- 1,3,4-Thiadiazole-2-sulfonyl chloride, 5-(acetylamino)-
- 1,3,4-Thiadiazole-2-sulfonyl chloride, 5-acetamido-
- 1,3,4-Thiadiazole-2-sulfonylchloride, 5-acetamido- (6CI,8CI)
- 2-Acetamido-1,3,4-thiadiazole-5-sulfonyl chloride
- 2-Acetamido-1,3,4-thiadiazole-5-sulfonylchloride
- 2-Acetamido-5-chlorosulfonyl-1,3,4-thiadiazole
- 5-(Acetylamino)-1,3,4-thiadiazole-2-sulfonyl chloride
- Acetazolamide Impurity 10
- 5-acetamido-1,3,4-thiadiazolyl-2-sulfonyl chloride
- 2-(Acetamido)-5-(chlorosulfonyl)-1,3,4-thiadiazole 5-(Acetylamino)-1,3,4-thiadiazole-2-sulfonyl chloride
- Acetazolamide Impurity 8
- Acetazolamide Sulfonylchloride Impurity
- 5-acetamido-1,3,4-thiadiazole-2-sulfonyl chloride
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

