CAS 3289-38-1

4-Amino-6-chloro-2-diethylaminopyrimidine

Description:

4-Amino-6-chloro-2-diethylaminopyrimidine is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features an amino group (-NH2) at the 4-position and a chloro group (-Cl) at the 6-position, contributing to its reactivity and potential biological activity. The presence of two diethylamino groups at the 2-position enhances its basicity and solubility in organic solvents. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its chemical properties make it of interest in various fields, including medicinal chemistry and agrochemicals, where it may serve as a precursor or intermediate in the synthesis of more complex molecules. Additionally, the presence of both amino and chloro functional groups suggests potential for further chemical modifications, which can be explored for developing new pharmaceuticals or agrochemical agents. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₈H₁₃ClN₄

InChI: InChI=1/C8H13ClN4/c1-3-13(4-2)8-11-6(9)5-7(10)12-8/h5H,3-4H2,1-2H3,(H2,10,11,12)

SMILES: CCN(CC)c1nc(cc(=N)[nH]1)Cl

Synonyms:

• 2,4-pyrimidinediamine, 6-chloro-N2,N2-diethyl-
• 6-Chloro-N2,N2-diethylpyrimidine-2,4-diamine
• 6-chloro-N2,N2-diethyl-pyrimidine-2,4-diamine

6-chloro-N~2~,N~2~-diethyl-2,4-pyrimidinediamine

CAS: 3289-38-1

Formula: C₈H₁₃ClN₄

Molecular weight: 200.6686

Ref: IN-DA00C8EN

6-Chloro-N2,N2-diethylpyrimidine-2,4-diamine

CAS: 3289-38-1

Formula: C₈H₁₃ClN₄

Purity: 95.0%

Molecular weight: 200.67

Ref: 10-F233160