CAS 32890-87-2
:2,4-Bis(trifluoromethyl)benzoic acid
Description:
2,4-Bis(trifluoromethyl)benzoic acid is an aromatic carboxylic acid characterized by the presence of two trifluoromethyl groups attached to the benzene ring at the 2 and 4 positions. This compound is notable for its high electronegativity due to the trifluoromethyl groups, which significantly influence its chemical reactivity and physical properties. It typically appears as a white crystalline solid and is sparingly soluble in water but more soluble in organic solvents. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the trifluoromethyl groups enhance the compound's lipophilicity and thermal stability, making it useful in various applications, including pharmaceuticals and agrochemicals. Its unique structure also contributes to its potential as a building block in organic synthesis and materials science. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C9H3F6O2
InChI:InChI=1/C9H4F6O2/c10-8(11,12)4-1-2-5(7(16)17)6(3-4)9(13,14)15/h1-3H,(H,16,17)/p-1
SMILES:c1cc(c(cc1C(F)(F)F)C(F)(F)F)C(=O)[O-]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,4-Bis(trifluoromethyl)benzoic acid
CAS:Formula:C9H4F6O2Purity:98%Color and Shape:SolidMolecular weight:258.11732,4-Bis(trifluoromethyl)benzoic acid
CAS:2,4-Bis(trifluoromethyl)benzoic acidFormula:C9H4F6O2Purity:98%Color and Shape: white crystalline solidMolecular weight:258.12g/mol2,4-Bis(trifluoromethyl)benzoic acid
CAS:2,4-Bis(trifluoromethyl)benzoic acid (2,4-BTFBA) is a styrene derivative that can be used as a matrix in the preparation of polystyrene for MALDI mass spectrometry analysis. 2,4-BTFBA is a monomer that has been shown to lead to high yields and transfer in the production of polystyrene and poly(methyl methacrylate). It has also been found to be an effective inhibitor of 2,5-dihydroxybenzoic acid (DHBA) and other DHBA derivatives. The inhibition mechanism of 2,4-BTFBA on DHBA activity is not yet clear. The nature of this compound as well as its use in matrix-assisted laser desorption/ionization are still under investigation.Formula:C9H4F6O2Purity:Min. 95%Color and Shape:PowderMolecular weight:258.12 g/mol2,4-Bis(trifluoromethyl)benzoic acid
CAS:Formula:C9H4F6O2Purity:98%Color and Shape:Crystalline Powder,PowderMolecular weight:258.119




