CymitQuimica logo

CAS 32890-91-8

:

2,3-dichloro-6-fluorobenzoic acid

Description:
2,3-Dichloro-6-fluorobenzoic acid is an aromatic carboxylic acid characterized by the presence of two chlorine atoms and one fluorine atom substituted on a benzoic acid framework. The molecular structure features a benzene ring with the carboxylic acid (-COOH) functional group, which imparts acidic properties. This compound is typically a solid at room temperature and is soluble in organic solvents, with limited solubility in water due to its hydrophobic aromatic nature. The presence of halogen substituents can influence its reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, which can be attributed to its structural features. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental concerns. Proper storage and disposal methods are essential to mitigate any risks associated with its use.
Formula:C7H3Cl2FO2
InChI:InChI=1/C7H3Cl2FO2/c8-3-1-2-4(10)5(6(3)9)7(11)12/h1-2H,(H,11,12)
InChI key:InChIKey=OOQKLNYJVMPYIF-UHFFFAOYSA-N
SMILES:c1cc(c(c(c1Cl)Cl)C(=O)O)F
Synonyms:
  • Benzoic Acid, 2,3-Dichloro-6-Fluoro-
  • Qvr Bg Cg Ff
  • 2,3-Dichloro-6-fluorobenzoic acid
Found 4 products.