CAS 328925-71-9

1-(4-chlorophenyl)-3-(5-ethyl-2-hydroxyphenyl)propane-1,3-dione

Description:

1-(4-chlorophenyl)-3-(5-ethyl-2-hydroxyphenyl)propane-1,3-dione, identified by its CAS number 328925-71-9, is an organic compound characterized by its complex structure featuring a propane backbone with two diketone functional groups. This compound includes a 4-chlorophenyl group and a 5-ethyl-2-hydroxyphenyl substituent, contributing to its potential biological activity and chemical reactivity. The presence of the hydroxyl group suggests that it may exhibit hydrogen-bonding capabilities, influencing its solubility and interaction with other molecules. The chlorophenyl moiety can enhance lipophilicity, while the ethyl and hydroxyl groups may affect its steric and electronic properties. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Additionally, the specific arrangement of substituents can lead to unique optical properties, making it of interest in materials science. Overall, the compound's characteristics make it a subject of interest in various fields of chemical research.

Formula: C₁₇H₁₅ClO₃

InChI: InChI=1/C17H15ClO3/c1-2-11-3-8-15(19)14(9-11)17(21)10-16(20)12-4-6-13(18)7-5-12/h3-9,19H,2,10H2,1H3

SMILES: CCc1ccc(c(c1)C(=O)CC(=O)c1ccc(cc1)Cl)O

Synonyms:

• 1,3-Propanedione, 1-(4-chlorophenyl)-3-(5-ethyl-2-hydroxyphenyl)-
• 1-(4-Chlorophenyl)-3-(5-ethyl-2-hydroxyphenyl)propane-1,3-dione

1-(5-Ethyl-2-hydroxyphenyl)-3-(4-chlorophenyl)-1,3-propanedione

CAS: 328925-71-9

Formula: C₁₇H₁₅ClO₃

Color and Shape: Solid

Molecular weight: 302.75

Ref: 10-F012204