CAS 328977-86-2

2-[(4-oxo-1,4-dihydroquinazolin-2-yl)sulfanyl]propanoic acid

Description:

2-[(4-oxo-1,4-dihydroquinazolin-2-yl)sulfanyl]propanoic acid is a chemical compound characterized by its unique structure, which includes a quinazolinone moiety and a propanoic acid functional group. This compound features a sulfanyl (thioether) linkage, which contributes to its reactivity and potential biological activity. The presence of the 4-oxo group indicates that it has a carbonyl functional group, which can participate in various chemical reactions, such as nucleophilic attacks. The compound is likely to exhibit properties typical of both acidic and basic functionalities due to the carboxylic acid group, which can donate protons in solution. Its structural complexity suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Additionally, the compound's solubility, stability, and reactivity can be influenced by the surrounding functional groups and the overall molecular conformation. As with many compounds containing heterocycles, it may also exhibit interesting pharmacological properties, warranting further investigation in drug discovery contexts.

Formula: C₁₁H₁₀N₂O₃S

InChI: InChI=1/C11H10N2O3S/c1-6(10(15)16)17-11-12-8-5-3-2-4-7(8)9(14)13-11/h2-6H,1H3,(H,15,16)(H,12,13,14)

SMILES: CC(C(=O)O)Sc1nc2ccccc2c(n1)O

Synonyms:

• Propanoic acid, 2-[(1,4-dihydro-4-oxo-2-quinazolinyl)thio]-
• Propanoic Acid, 2-[(3,4-Dihydro-4-Oxo-2-Quinazolinyl)Thio]-
• 2-[(4-Oxo-1,4-dihydroquinazolin-2-yl)sulfanyl]propanoic acid

2-(4-Oxo-1,4-dihydro-quinazolin-2-ylsulfanyl)-propionic acid

CAS: 328977-86-2

Formula: C₁₁H₁₀N₂O₃S

Purity: 95.0%

Molecular weight: 250.27

Ref: 10-F028915