CAS 329-99-7
:Cyclosarin
Description:
Cyclosarin, with the CAS number 329-99-7, is a highly toxic organophosphorus compound classified as a nerve agent. It is a colorless, odorless liquid at room temperature and is known for its potent inhibition of the enzyme acetylcholinesterase, leading to the accumulation of acetylcholine in the synaptic cleft. This accumulation disrupts normal neurotransmission, resulting in severe physiological effects, including muscle paralysis and respiratory failure. Cyclosarin is structurally similar to other nerve agents, featuring a cyclic structure that contributes to its stability and toxicity. It is classified as a weapon of mass destruction under the Chemical Weapons Convention due to its potential for use in warfare and terrorism. Due to its extreme toxicity, cyclosarin poses significant risks to human health and the environment, necessitating stringent handling and disposal protocols. Its use is strictly regulated, and exposure can lead to acute symptoms and long-term health effects, making it a subject of concern for both military and public health authorities.
Formula:C7H14FO2P
InChI:InChI=1S/C7H14FO2P/c1-11(8,9)10-7-5-3-2-4-6-7/h7H,2-6H2,1H3
InChI key:InChIKey=SNTRKUOVAPUGAY-UHFFFAOYSA-N
SMILES:O(P(C)(F)=O)C1CCCCC1
Synonyms:- Cyclosarin
- Cyclosin
- Cyclosin (chemical warfare agent)
- GF (chemical warfare agent)
- Methyl cyclohexylfluorophosphonate
- O-Cyclohexyl methylphosphonofluoridate
- Phosphonofluoridic acid, methyl-, cyclohexyl ester
- [Fluoro(methyl)phosphoryl]oxycyclohexane
- phosphonofluoridic acid, P-methyl-, cyclohexyl ester
- Cyclohexyl methylphosphonofluoridate
- CMPF
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
(Fluoro-Methylphosphoryl)Oxycyclohexane
CAS:Controlled Product<p>(Fluoro-Methylphosphoryl)Oxycyclohexane is an organophosphorus compound that acts as a nerve agent. It inhibits the enzyme acetylcholinesterase, which is responsible for breaking down acetylcholine, leading to excess cholinergic stimulation. This can cause excessive contraction of muscles or even death. The exposure to (Fluoro-Methylphosphoryl)Oxycyclohexane can be detected by analytical methods such as gas chromatography/mass spectrometry. Oximes are used in the reactivation of acetylcholinesterase and are effective in preventing neuronal death. They bind to the phosphonyl group in (Fluoro-Methylphosphoryl)Oxycyclohexane and prevent it from inhibiting the enzyme acetylcholinesterase.</p>Formula:C7H14FO2PPurity:Min. 95%Molecular weight:180.16 g/mol
