CAS 329014-60-0
:2,3-Difluoro-4-methoxybenzoic acid
Description:
2,3-Difluoro-4-methoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of two fluorine atoms and a methoxy group on a benzoic acid framework. The fluorine substituents are located at the 2 and 3 positions, while the methoxy group is at the 4 position, influencing the compound's electronic properties and reactivity. This compound typically appears as a solid at room temperature and is soluble in polar organic solvents due to the presence of the carboxylic acid functional group. Its molecular structure contributes to its potential applications in pharmaceuticals and agrochemicals, where the fluorine atoms can enhance biological activity and metabolic stability. The presence of the methoxy group can also affect the compound's lipophilicity and overall pharmacokinetic properties. As with many fluorinated compounds, 2,3-difluoro-4-methoxybenzoic acid may exhibit unique interactions with biological systems, making it of interest in medicinal chemistry and material science. Safety data and handling precautions should be observed due to the potential hazards associated with fluorinated compounds.
Formula:C8H6F2O3
InChI:InChI=1S/C8H6F2O3/c1-13-5-3-2-4(8(11)12)6(9)7(5)10/h2-3H,1H3,(H,11,12)
InChI key:InChIKey=OBSJPUVORWCLNA-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(F)C(F)=C(OC)C=C1
Synonyms:- Benzoic acid, 2,3-difluoro-4-methoxy-
- Qvr Bf Cf Do1
- 2,3-Difluoro-4-methoxybenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzoic acid, 2,3-difluoro-4-methoxy-
CAS:Formula:C8H6F2O3Purity:98%Color and Shape:SolidMolecular weight:188.12822,3-Difluoro-4-methoxybenzoic acid
CAS:2,3-Difluoro-4-methoxybenzoic acidFormula:C8H6F2O3Purity:98%Molecular weight:188.13g/mol2,3-Difluoro-4-methoxybenzoic acid
CAS:2,3-Difluoro-4-methoxybenzoic acid is a versatile building block that can be used to make complex compounds. This compound is a high quality, useful intermediate and reaction component that can be used in the synthesis of pharmaceuticals and other chemical products. 2,3-Difluoro-4-methoxybenzoic acid is a reagent that can be used for research purposes or as a speciality chemical. It has been shown to have many uses as a scaffold for making new compounds with different structures.Formula:C8H6F2O3Purity:Min. 95%Color and Shape:PowderMolecular weight:188.13 g/mol2,3-Difluoro-4-methoxybenzoic acid
CAS:Formula:C8H6F2O3Purity:98%Color and Shape:SolidMolecular weight:188.13



