CymitQuimica logo

CAS 329064-07-5

:

1,5-dimethyl-1H-1,2,3-triazole-4-carboxylic acid

Description:
1,5-Dimethyl-1H-1,2,3-triazole-4-carboxylic acid is a heterocyclic organic compound characterized by its triazole ring structure, which contains three nitrogen atoms and two carbon atoms. This compound features two methyl groups attached to the first carbon of the triazole ring and a carboxylic acid functional group at the fourth position. The presence of the carboxylic acid group contributes to its acidity and potential for forming hydrogen bonds, which can enhance its solubility in polar solvents. The triazole moiety is known for its biological activity, making this compound of interest in pharmaceutical and agricultural applications. Additionally, the compound may exhibit properties such as antimicrobial or antifungal activity, although specific biological activities would depend on further empirical studies. Its molecular structure allows for various potential interactions with other molecules, making it a candidate for research in drug development and material science. Overall, 1,5-dimethyl-1H-1,2,3-triazole-4-carboxylic acid is a versatile compound with significant implications in various fields of chemistry and biochemistry.
Formula:C5H7N3O2
InChI:InChI=1/C5H7N3O2/c1-3-4(5(9)10)6-7-8(3)2/h1-2H3,(H,9,10)
SMILES:Cc1c(C(=O)O)nnn1C
Synonyms:
  • 1H-1,2,3-triazole-4-carboxylic acid, 1,5-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.