CAS 32909-05-0: N-Acetyl-2'-deoxycytidine
Description:N-Acetyl-2'-deoxycytidine, with the CAS number 32909-05-0, is a nucleoside analog that plays a significant role in biochemical research and pharmaceutical applications. It is a derivative of the nucleoside deoxycytidine, where an acetyl group is attached to the nitrogen atom at the 1-position of the cytosine base. This modification enhances its solubility and stability compared to its parent compound. N-Acetyl-2'-deoxycytidine is characterized by its ability to participate in various biochemical reactions, including those involved in nucleic acid synthesis and metabolism. It is often used in studies related to DNA synthesis, epigenetics, and as a potential therapeutic agent in antiviral and anticancer treatments. The compound is typically white to off-white in appearance and is soluble in water and organic solvents, making it versatile for laboratory use. Its structural characteristics allow it to mimic natural nucleosides, which is crucial for its function in biological systems.
Formula:C11H15N3O5
InChI:InChI=1/C11H15N3O5/c1-6(16)12-9-2-3-14(11(18)13-9)10-4-7(17)8(5-15)19-10/h2-3,7-8,10,15,17H,4-5H2,1H3,(H,12,13,16,18)/t7-,8+,10+/m0/s1
- Synonyms:
- cytidine, N-acetyl-2'-deoxy-
- Ac-dC
- N4-Acetyl-2'-Deoxycytidine
