CAS 32909-05-0
:N-Acetyl-2'-deoxycytidine
Description:
N-Acetyl-2'-deoxycytidine, with the CAS number 32909-05-0, is a nucleoside analog that plays a significant role in biochemical research and pharmaceutical applications. It is a derivative of the nucleoside deoxycytidine, where an acetyl group is attached to the nitrogen atom at the 1-position of the cytosine base. This modification enhances its solubility and stability compared to its parent compound. N-Acetyl-2'-deoxycytidine is characterized by its ability to participate in various biochemical reactions, including those involved in nucleic acid synthesis and metabolism. It is often used in studies related to DNA synthesis, epigenetics, and as a potential therapeutic agent in antiviral and anticancer treatments. The compound is typically white to off-white in appearance and is soluble in water and organic solvents, making it versatile for laboratory use. Its structural characteristics allow it to mimic natural nucleosides, which is crucial for its function in biological systems.
Formula:C11H15N3O5
InChI:InChI=1/C11H15N3O5/c1-6(16)12-9-2-3-14(11(18)13-9)10-4-7(17)8(5-15)19-10/h2-3,7-8,10,15,17H,4-5H2,1H3,(H,12,13,16,18)/t7-,8+,10+/m0/s1
Synonyms:- cytidine, N-acetyl-2'-deoxy-
- Ac-dC
- N4-Acetyl-2'-Deoxycytidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
N4-Acetyl-2'-deoxycytidine
CAS:Formula:C11H15N3O5Purity:97%Color and Shape:SolidMolecular weight:269.2539N4-Acetyl-2'-deoxycytidine
CAS:Nucleoside Derivatives –Other modified nucleosidesFormula:C11H15N3O5Color and Shape:SolidMolecular weight:269.25Ref: TM-TNU1463
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquireN4-Acetyl-2''-deoxycytidine
CAS:Formula:C11H15N3O5Purity:≥ 99.0%Color and Shape:White to off-white crystalline powderMolecular weight:269.3N4-Acetyl-2'-deoxycytidine
CAS:N4-Acetyl-2'-deoxycytidine is a nucleoside analogue that acts as an inhibitor of DNA synthesis. It binds to the active site of the enzyme ribonucleotide reductase, blocking the conversion of ribonucleotides to deoxyribonucleotides. This prevents DNA synthesis and replication, which leads to cell death. N4-Acetyl-2'-deoxycytidine has been shown to be more efficient than other analogues in terms of energy efficiency, control levels, and constant linear model. This compound is reactive and can cause low yields when isolated from solutions with high concentrations. A diode can be used for analytical purposes, while calcium binding may be used as a mathematical model in order to analyze this drug.Formula:C11H15N3O5Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:269.25 g/molN-(1-((2R,4S,5R)-4-Hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-2-oxo-1,2-dihydropyrimidin-4-yl)acetamide
CAS:Formula:C11H15N3O5Purity:98%Color and Shape:SolidMolecular weight:269.257N4-Acetyldeoxycytidine
CAS:Controlled ProductFormula:C11H15N3O5Color and Shape:NeatMolecular weight:269.25






