CAS 32910-58-0

4-(heptylsulfanyl)benzoic acid

Description:

4-(Heptylsulfanyl)benzoic acid is an organic compound characterized by a benzoic acid structure substituted with a heptylsulfanyl group at the para position. This compound features a long hydrophobic heptyl chain, which contributes to its unique solubility properties, making it more soluble in organic solvents than in water. The presence of the sulfanyl (thioether) functional group introduces sulfur into the molecular structure, which can influence its reactivity and interactions with other chemical species. The carboxylic acid functional group (-COOH) provides acidic properties, allowing for potential hydrogen bonding and participation in acid-base reactions. This compound may exhibit interesting physical properties, such as melting and boiling points, influenced by the length of the heptyl chain and the overall molecular weight. Additionally, its structural characteristics may make it useful in various applications, including materials science, pharmaceuticals, or as a surfactant, depending on its specific interactions and behavior in different environments.

Formula: C₁₄H₂₀O₂S

InChI: InChI=1/C14H20O2S/c1-2-3-4-5-6-11-17-13-9-7-12(8-10-13)14(15)16/h7-10H,2-6,11H2,1H3,(H,15,16)

4-(Heptylsulfanyl)benzoic acid

CAS: 32910-58-0

Versatile small molecule scaffold

Formula: C₁₄H₂₀O₂S

Purity: Min. 95%

Molecular weight: 252.37 g/mol

Ref: 3D-HBA91058