CAS 3292-77-1

2-(Bromoacetyl)-1,3-thiazole

Description:

2-(Bromoacetyl)-1,3-thiazole is a heterocyclic organic compound characterized by the presence of both a thiazole ring and a bromoacetyl functional group. The thiazole moiety contributes to its aromatic properties and potential reactivity, while the bromoacetyl group introduces a halogen and a carbonyl functionality, making it a versatile intermediate in organic synthesis. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents such as dichloromethane and acetone but has limited solubility in water due to its hydrophobic thiazole structure. The presence of the bromine atom enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, compounds like 2-(Bromoacetyl)-1,3-thiazole may exhibit biological activity, which can be explored in medicinal chemistry for potential pharmaceutical applications. Proper handling and storage are essential due to its reactivity and potential hazards associated with brominated compounds.

Formula: C₅H₄BrNOS

InChI: InChI=1/C5H4BrNOS/c6-3-4(8)5-7-1-2-9-5/h1-2H,3H2

SMILES: c1csc(C(=O)CBr)n1

Synonyms:

• 2-Bromo-1-(1,3-thiazol-2-yl)ethanone
• 2-Bromo-1-(Thiazol-2-Yl)Ethanone

2-BROMO-1-(1,3-THIAZOL-2-YL)ETHANONE

CAS: 3292-77-1

Formula: C₅H₄BrNOS

Purity: 96%

Color and Shape: Solid

Molecular weight: 206.0604

Ref: IN-DA00BZI8

2-(Bromoacetyl)-1,3-thiazole

CAS: 3292-77-1

2-(Bromoacetyl)-1,3-thiazole

Formula: C₅H₄BrNOS

Purity: 95%

Color and Shape: red brown solid

Molecular weight: 206.06g/mol

Ref: 54-OR2881

1-Bromo-(1,3-thiazole-2-yl)ethane-2-one

CAS: 3292-77-1

Please enquire for more information about 1-Bromo-(1,3-thiazole-2-yl)ethane-2-one including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₅H₄BrNOS

Purity: Min. 95%

Molecular weight: 206.06 g/mol

Ref: 3D-FB06164

2-Bromo-1-(1,3-thiazol-2-yl)ethanone

CAS: 3292-77-1

Formula: C₅H₄BrNOS

Purity: 95%

Color and Shape: Solid

Molecular weight: 206.06

Ref: 10-F064664

2-Bromo-1-(1,3-thiazol-2-yl)ethanone

Controlled Product

CAS: 3292-77-1

Stability Light Sensitive, Moisture Sensitive
Applications 2-Bromo-1-(1,3-thiazol-2-yl)ethanone

Formula: C₅H₄BrNOS

Color and Shape: Neat

Molecular weight: 206.06

Ref: TR-B688408