CAS 329217-03-0

methyl 2-{[5-(benzyloxy)-2-nitrophenyl]sulfanyl}benzoate

Description:

Methyl 2-{[5-(benzyloxy)-2-nitrophenyl]sulfanyl}benzoate is an organic compound characterized by its complex structure, which includes a benzoate moiety, a nitrophenyl group, and a benzyloxy substituent. The presence of the nitro group indicates potential electrophilic reactivity, while the benzyloxy group contributes to the compound's lipophilicity and may influence its solubility in organic solvents. The sulfanyl (thioether) linkage introduces unique properties, such as potential nucleophilicity and the ability to participate in various chemical reactions, including substitution and oxidation. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests that it could interact with biological targets, potentially leading to therapeutic applications. Additionally, the presence of multiple functional groups allows for further derivatization, which can be explored for enhancing its properties or efficacy in specific applications. Overall, methyl 2-{[5-(benzyloxy)-2-nitrophenyl]sulfanyl}benzoate is a versatile compound with potential implications in various fields of chemistry and pharmacology.

Formula: C₂₁H₁₇NO₅S

InChI: InChI=1/C21H17NO5S/c1-26-21(23)17-9-5-6-10-19(17)28-20-13-16(11-12-18(20)22(24)25)27-14-15-7-3-2-4-8-15/h2-13H,14H2,1H3

SMILES: COC(=O)c1ccccc1Sc1cc(ccc1N(=O)=O)OCc1ccccc1

4-Benzyloxy-2-(2’-carbomethoxy)thiophenylnitrobenzene

Controlled Product

CAS: 329217-03-0

Applications 4-Benzyloxy-2-(2’-carbomethoxy)thiophenylnitrobenzene (cas# 329217-03-0) is a compound useful in organic synthesis.

Formula: C₂₁H₁₇NO₅S

Color and Shape: Yellow

Molecular weight: 395.43

Ref: TR-B285888