CAS 329217-07-4
:7-(Phenylmethoxy)dibenzo[b,f][1,4]thiazepin-11(10H)-one
Description:
7-(Phenylmethoxy)dibenzo[b,f][1,4]thiazepin-11(10H)-one is a chemical compound characterized by its complex structure, which includes a thiazepine ring fused with two benzene rings. This compound features a phenylmethoxy group, which contributes to its unique chemical properties and potential biological activity. The thiazepine moiety is known for its presence in various pharmacologically active compounds, often exhibiting properties such as antipsychotic, anxiolytic, or antidepressant effects. The presence of the phenylmethoxy substituent may enhance lipophilicity, potentially influencing the compound's solubility and permeability, which are critical for its bioavailability. Additionally, the compound's structure suggests the possibility of engaging in various chemical interactions, such as hydrogen bonding and π-π stacking, which could be relevant in drug design and development. Overall, 7-(Phenylmethoxy)dibenzo[b,f][1,4]thiazepin-11(10H)-one represents a class of compounds that may hold promise in medicinal chemistry, warranting further investigation into its pharmacological properties and applications.
Formula:C20H15NO2S
InChI:InChI=1S/C20H15NO2S/c22-20-16-8-4-5-9-18(16)24-19-12-15(10-11-17(19)21-20)23-13-14-6-2-1-3-7-14/h1-12H,13H2,(H,21,22)
InChI key:InChIKey=ILEHOLFZCSNFEM-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C=2C=C3C(NC(=O)C=4C(S3)=CC=CC4)=CC2
Synonyms:- 7-(Phenylmethoxy)dibenzo[b,f][1,4]thiazepin-11(10H)-one
- Dibenzo[b,f][1,4]thiazepin-11(10H)-one, 7-(phenylmethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
7-Benzyloxy-10,11-dihydrodibenzo[b,f[[1,4]thiazepin-11-one
CAS:Controlled Product<p>Applications 7-Benzyloxy-10,11-dihydrodibenzo[b,f[[1,4]thiazepin-11-one (cas# 329217-07-4) is a compound useful in organic synthesis.<br></p>Formula:C20H15NO2SColor and Shape:NeatMolecular weight:333.40
