CAS 329222-74-4

4-Methoxy-3-[(2,3,4,5,6-pentachlorophenoxy)methyl]benzaldehyde

Description:

4-Methoxy-3-[(2,3,4,5,6-pentachlorophenoxy)methyl]benzaldehyde is a complex organic compound characterized by its aromatic structure and the presence of multiple functional groups. The compound features a methoxy group (-OCH3) and an aldehyde group (-CHO) attached to a benzene ring, which contributes to its reactivity and potential applications in organic synthesis. The presence of the pentachlorophenoxy moiety significantly enhances its hydrophobicity and may impart unique biological properties, making it of interest in various fields, including agrochemicals and pharmaceuticals. The chlorinated phenoxy group can influence the compound's stability, solubility, and interaction with biological systems. Additionally, the compound's molecular structure suggests potential for use in research related to environmental chemistry, particularly in studies involving chlorinated compounds and their effects. Safety and handling precautions are essential due to the presence of chlorine atoms, which can pose environmental and health risks. Overall, this compound exemplifies the complexity and diversity of synthetic organic chemistry.

Formula: C₁₅H₉Cl₅O₃

InChI: InChI=1S/C15H9Cl5O3/c1-22-9-3-2-7(5-21)4-8(9)6-23-15-13(19)11(17)10(16)12(18)14(15)20/h2-5H,6H2,1H3

InChI key: InChIKey=XIXCSLNZWBYGHA-UHFFFAOYSA-N

SMILES: O(CC1=C(OC)C=CC(C=O)=C1)C2=C(Cl)C(Cl)=C(Cl)C(Cl)=C2Cl

Synonyms:

• Benzaldehyde, 4-methoxy-3-[(pentachlorophenoxy)methyl]-
• 4-Methoxy-3-[(2,3,4,5,6-pentachlorophenoxy)methyl]benzaldehyde
• Benzaldehyde, 4-methoxy-3-[(2,3,4,5,6-pentachlorophenoxy)methyl]-

4-Methoxy-3-(pentachlorophenoxymethyl)benzaldehyde

CAS: 329222-74-4

Versatile small molecule scaffold

Formula: C₁₅H₉Cl₅O₃

Purity: Min. 95%

Molecular weight: 414.5 g/mol

Ref: 3D-ENA22274