CymitQuimica logo

CAS 329222-77-7

:

3-[(4-Chlorophenoxy)methyl]-4-methoxybenzaldehyde

Description:
3-[(4-Chlorophenoxy)methyl]-4-methoxybenzaldehyde is an organic compound characterized by its complex structure, which includes a benzaldehyde functional group, a methoxy group, and a chlorophenoxy moiety. This compound typically appears as a solid or crystalline substance and is soluble in organic solvents such as ethanol and dichloromethane, but may have limited solubility in water due to its hydrophobic characteristics. The presence of the chlorophenoxy group can impart specific biological activities, making it of interest in medicinal chemistry and agrochemical applications. Its molecular structure suggests potential reactivity in electrophilic aromatic substitution reactions, and it may serve as a precursor for synthesizing other chemical entities. Additionally, the compound's properties, such as melting point, boiling point, and spectral data (NMR, IR, etc.), can provide further insights into its behavior and applications in various chemical contexts. As with any chemical substance, proper handling and safety precautions should be observed due to potential toxicity or reactivity.
Formula:C15H13ClO3
InChI:InChI=1S/C15H13ClO3/c1-18-15-7-2-11(9-17)8-12(15)10-19-14-5-3-13(16)4-6-14/h2-9H,10H2,1H3
InChI key:InChIKey=DTLLHBACWDTJEK-UHFFFAOYSA-N
SMILES:C(OC1=CC=C(Cl)C=C1)C2=C(OC)C=CC(C=O)=C2
Synonyms:
  • Benzaldehyde, 3-[(4-chlorophenoxy)methyl]-4-methoxy-
  • 3-[(4-Chlorophenoxy)methyl]-4-methoxybenzaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.