CAS 329222-83-5

3-[(3,5-Dimethylphenoxy)methyl]-4-methoxybenzaldehyde

Description:

3-[(3,5-Dimethylphenoxy)methyl]-4-methoxybenzaldehyde, with the CAS number 329222-83-5, is an organic compound characterized by its complex structure, which includes a benzaldehyde functional group and a methoxy group. This compound features a phenoxy group that is substituted with two methyl groups at the 3 and 5 positions, contributing to its hydrophobic characteristics and potential biological activity. The presence of the aldehyde functional group indicates that it can participate in various chemical reactions, such as condensation and oxidation. The methoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. This compound may be of interest in medicinal chemistry and material science due to its potential applications in drug development or as a building block for synthesizing more complex molecules. Its specific physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from reliable chemical databases for practical applications.

Formula: C₁₇H₁₈O₃

InChI: InChI=1S/C17H18O3/c1-12-6-13(2)8-16(7-12)20-11-15-9-14(10-18)4-5-17(15)19-3/h4-10H,11H2,1-3H3

InChI key: InChIKey=QFNZCIQKNJFSAA-UHFFFAOYSA-N

SMILES: C(OC1=CC(C)=CC(C)=C1)C2=C(OC)C=CC(C=O)=C2

Synonyms:

• 3-[(3,5-Dimethylphenoxy)methyl]-4-methoxybenzaldehyde
• Benzaldehyde, 3-[(3,5-dimethylphenoxy)methyl]-4-methoxy-

3-[(3,5-Dimethylphenoxy)methyl]-4-methoxybenzaldehyde

CAS: 329222-83-5

Versatile small molecule scaffold

Formula: C₁₇H₁₈O₃

Purity: Min. 95%

Molecular weight: 270.32 g/mol

Ref: 3D-ENA22283