CAS 32933-03-2: ethyl 1-acetylcyclopropanecarboxylate

Description:Ethyl 1-acetylcyclopropanecarboxylate is an organic compound characterized by its unique cyclopropane structure, which contributes to its reactivity and stability. It features an ethyl ester functional group, making it soluble in organic solvents and exhibiting moderate polarity. The presence of the acetyl group enhances its reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and cycloadditions. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure includes a cyclopropane ring, which is known for its angle strain, potentially leading to interesting chemical behavior. Additionally, ethyl 1-acetylcyclopropanecarboxylate may exhibit specific physical properties such as boiling and melting points that are influenced by its molecular weight and functional groups. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula:C₈H₁₂O₃

InChI:InChI=1/C8H12O3/c1-3-11-7(10)8(4-5-8)6(2)9/h3-5H2,1-2H3

Synonyms:
1-Acetyl-1-cyclopropancarbonic acid ethyl ester
Cyclopropanecarboxylic acid, 1-acetyl-, ethyl ester

Found 5 products.

Product data	Purity	Price range	Estimated delivery
Ethyl 1-acetylcyclopropanecarboxylate REF: IN-DA007IE9CAS: 32933-03-2	97%	25.00 €~311.00 €	Tue 15 Apr 25
Ethyl 1-Acetylcyclopropane-1-carboxylate REF: 3B-E1442CAS: 32933-03-2	>98.0%(GC)	72.00 €~233.00 €	Mon 21 Apr 25
Ethyl 1-acetylcyclopropane-1-carboxylate REF: 54-OR303026CAS: 32933-03-2	97%	32.00 €~1,274.00 €	Tue 22 Apr 25
Ethyl 1-acetylcyclopropanecarboxylate REF: 10-F218344CAS: 32933-03-2	95.0%	To inquire	Fri 25 Apr 25
Ethyl 1-acetylcyclopropane-1-carboxylate REF: 3D-HBA93303CAS: 32933-03-2	Min. 95%	To inquire	Tue 27 May 25