CAS 32933-03-2

ethyl 1-acetylcyclopropanecarboxylate

Description:

Ethyl 1-acetylcyclopropanecarboxylate is an organic compound characterized by its unique cyclopropane structure, which contributes to its reactivity and stability. It features an ethyl ester functional group, making it soluble in organic solvents and exhibiting moderate polarity. The presence of the acetyl group enhances its reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and cycloadditions. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure includes a cyclopropane ring, which is known for its angle strain, potentially leading to interesting chemical behavior. Additionally, ethyl 1-acetylcyclopropanecarboxylate may exhibit specific physical properties such as boiling and melting points that are influenced by its molecular weight and functional groups. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₈H₁₂O₃

InChI: InChI=1/C8H12O3/c1-3-11-7(10)8(4-5-8)6(2)9/h3-5H2,1-2H3

SMILES: CCOC(=O)C1(CC1)C(=O)C

Synonyms:

• 1-Acetyl-1-cyclopropancarbonic acid ethyl ester
• Cyclopropanecarboxylic acid, 1-acetyl-, ethyl ester

Ethyl 1-acetylcyclopropanecarboxylate

CAS: 32933-03-2

Formula: C₈H₁₂O₃

Purity: 95%

Color and Shape: Liquid

Molecular weight: 156.1791

Ref: IN-DA007IE9

Ethyl 1-Acetylcyclopropane-1-carboxylate

CAS: 32933-03-2

Formula: C₈H₁₂O₃

Purity: >98.0%(GC)

Color and Shape: Colorless to Light yellow clear liquid

Molecular weight: 156.18

Ref: 3B-E1442

Ethyl 1-acetylcyclopropane-1-carboxylate

CAS: 32933-03-2

Ethyl 1-acetylcyclopropane-1-carboxylate

Formula: C₈H₁₂O₃

Purity: 97%

Color and Shape: Liquid

Molecular weight: 156.17908g/mol

Ref: 54-OR303026

Ethyl 1-acetylcyclopropanecarboxylate

CAS: 32933-03-2

Formula: C₈H₁₂O₃

Purity: 95%

Color and Shape: Liquid

Molecular weight: 156.181

Ref: 10-F218344

Ethyl 1-acetylcyclopropane-1-carboxylate

CAS: 32933-03-2

Ethyl 1-acetylcyclopropane-1-carboxylate is a synthetic quinolone antibacterial agent. It has been shown to inhibit gram-positive bacteria, such as Streptococcus pyogenes, Staphylococcus aureus, and Enterococcus faecalis. The compound also inhibits the growth of other gram-positive pathogens, such as Propionibacterium acnes and Corynebacterium diphtheriae. Ethyl 1-acetylcyclopropane-1-carboxylate binds to the enzyme DNA gyrase, which is required for bacterial replication and transcription. This binding prevents DNA from unwinding during replication and transcription, which leads to cell death by inhibiting protein synthesis.

Formula: C₈H₁₂O₃

Purity: Min. 95%

Molecular weight: 156.18 g/mol

Ref: 3D-HBA93303