CymitQuimica logo

CAS 32936-76-8

:

1-Methylcyclobutanecarboxylic acid

Description:
1-Methylcyclobutanecarboxylic acid, with the CAS number 32936-76-8, is a cyclic carboxylic acid characterized by a cyclobutane ring substituted with a methyl group and a carboxylic acid functional group. This compound typically exhibits a colorless to pale yellow liquid form at room temperature and possesses a distinctive odor. Its molecular structure contributes to its unique chemical properties, including moderate solubility in polar solvents like water and higher solubility in organic solvents. The presence of the carboxylic acid group allows for acidic behavior, enabling it to participate in various chemical reactions, such as esterification and acid-base reactions. Additionally, 1-methylcyclobutanecarboxylic acid may exhibit moderate reactivity due to the strain in the cyclobutane ring, which can influence its stability and reactivity in synthetic applications. Overall, this compound is of interest in organic synthesis and may have potential applications in the development of pharmaceuticals or agrochemicals.
Formula:C6H10O2
InChI:InChI=1S/C6H10O2/c1-6(5(7)8)3-2-4-6/h2-4H2,1H3,(H,7,8)
InChI key:GCZGQVRHZLOCDD-UHFFFAOYSA-N
SMILES:CC1(CCC1)C(=O)O
Synonyms:
  • 1-Methylcyclobutane-1-carboxylic acid
Found 4 products.