CAS 32939-18-7
:3,3,5,5-tetramethylcyclohexanamine
Description:
3,3,5,5-Tetramethylcyclohexanamine, with the CAS number 32939-18-7, is an organic compound characterized by its cyclic structure and multiple methyl substituents. This amine features a cyclohexane ring with four methyl groups attached to the 3 and 5 positions, contributing to its steric bulk and influencing its chemical reactivity. The presence of the amine functional group imparts basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. The compound is typically colorless to pale yellow and may exhibit a distinct odor. Its solubility in organic solvents is generally favorable, while its solubility in water may be limited due to the hydrophobic nature of the cyclohexane ring and the bulky methyl groups. 3,3,5,5-Tetramethylcyclohexanamine is of interest in various fields, including organic synthesis and materials science, where it may serve as a building block or a curing agent in polymer formulations. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C10H21N
InChI:InChI=1/C10H21N/c1-9(2)5-8(11)6-10(3,4)7-9/h8H,5-7,11H2,1-4H3
SMILES:CC1(C)CC(CC(C)(C)C1)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
