CAS 32946-56-8
:methyl (2S)-2-amino-3-(1-tritylimidazol-4-yl)propanoate hydrochloride
Description:
Methyl (2S)-2-amino-3-(1-tritylimidazol-4-yl)propanoate hydrochloride is a chemical compound characterized by its specific structural features, including an amino acid backbone with a tritylimidazole moiety. This compound is typically a white to off-white crystalline solid, soluble in polar solvents such as water and methanol, which is common for hydrochloride salts. The presence of the hydrochloride group enhances its solubility and stability. As a derivative of an amino acid, it exhibits properties typical of amino acids, including the ability to participate in peptide bond formation. The tritylimidazole group may impart unique biological activities, potentially influencing its interactions in biochemical pathways. This compound is often utilized in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. Its stereochemistry, indicated by the (2S) designation, suggests specific spatial arrangements that can affect its biological activity and interactions with receptors or enzymes. Overall, methyl (2S)-2-amino-3-(1-tritylimidazol-4-yl)propanoate hydrochloride is a compound of interest in medicinal chemistry and biochemistry.
Formula:C26H26ClN3O2
InChI:InChI=1/C26H25N3O2.ClH/c1-31-25(30)24(27)17-23-18-29(19-28-23)26(20-11-5-2-6-12-20,21-13-7-3-8-14-21)22-15-9-4-10-16-22;/h2-16,18-19,24H,17,27H2,1H3;1H/t24-;/m0./s1
SMILES:COC(=O)[C@H](Cc1cn(cn1)C(c1ccccc1)(c1ccccc1)c1ccccc1)N.Cl
Synonyms:- Methyl 1-trityl-L-histidinate hydrochloride (1:1)
- H-His(Trt)-Ome ? Hcl
- H-His(Trt)-OMe・HCl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
H-His(1-Trt)-OMe · HCl
CAS:His(Trt)-OMe was converted into Fmoc-His(Trt)-OMe which served as a model compound for histidine π-alkylation.Formula:C26H25N3O2·HClPurity:> 98%Color and Shape:White PowderMolecular weight:447.97H-His(Trt)-OMe · HCl
CAS:Formula:C26H26ClN3O2Purity:97%Color and Shape:SolidMolecular weight:447.9565Nim-trityl-L-histidine methyl ester hydrochloride
CAS:Nim-trityl-L-histidine methyl ester hydrochloride is a versatile amino acid building block for the synthesis of complex compounds.
Formula:C26H25N3O2•HClPurity:Min. 95%Color and Shape:White PowderMolecular weight:447.96 g/mol



