CAS 3296-05-7
:1-azido-4-chlorobenzene
Description:
1-Azido-4-chlorobenzene is an organic compound characterized by the presence of both an azide group (-N3) and a chlorine atom attached to a benzene ring. Its molecular structure consists of a benzene ring substituted at the para position with a chlorine atom and an azido group. This compound is typically a pale yellow to light brown solid at room temperature and is known for its potential applications in organic synthesis and materials science, particularly in the development of energetic materials due to the presence of the azide functional group. 1-Azido-4-chlorobenzene is generally considered to be sensitive to heat and shock, which necessitates careful handling and storage. It is soluble in organic solvents such as acetone and dichloromethane but has limited solubility in water. The compound's reactivity is influenced by the electron-withdrawing nature of the chlorine atom, which can affect its behavior in nucleophilic substitution reactions. As with all azides, safety precautions are essential due to their potential explosiveness under certain conditions.
Formula:C6H4ClN3
InChI:InChI=1/C6H4ClN3/c7-5-1-3-6(4-2-5)9-10-8/h1-4H
SMILES:c1cc(ccc1Cl)N=[N+]=[NH-]
Synonyms:- 4-Chlorophenylazide
- Benzene, 1-azido-4-chloro-
- 1-Azido-4-chlorobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
