CymitQuimica logo

CAS 329722-32-9

:

1-[2-[3-[(1,1-Dimethylethyl)amino]-2-hydroxypropoxy]-5-nitrophenyl]ethanone

Description:
1-[2-[3-[(1,1-Dimethylethyl)amino]-2-hydroxypropoxy]-5-nitrophenyl]ethanone, with the CAS number 329722-32-9, is a synthetic organic compound characterized by its complex structure, which includes a nitrophenyl group, a hydroxypropoxy moiety, and a tert-butyl amino group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in various solvents. The presence of the nitro group suggests it may participate in electrophilic substitution reactions, while the hydroxy and amino functionalities can engage in hydrogen bonding, influencing its physical properties such as boiling point and solubility. Additionally, the tert-butyl group may provide steric hindrance, affecting the compound's reactivity and interaction with biological systems. Overall, this compound's unique structural features make it of interest in medicinal chemistry and material science, where it may serve as a precursor or intermediate in the synthesis of more complex molecules.
Formula:C15H22N2O5
InChI:InChI=1S/C15H22N2O5/c1-10(18)13-7-11(17(20)21)5-6-14(13)22-9-12(19)8-16-15(2,3)4/h5-7,12,16,19H,8-9H2,1-4H3
InChI key:InChIKey=UTFMIXVPSUKJQJ-UHFFFAOYSA-N
SMILES:O(CC(CNC(C)(C)C)O)C1=C(C(C)=O)C=C(N(=O)=O)C=C1
Synonyms:
  • Ethanone, 1-[2-[3-[(1,1-dimethylethyl)amino]-2-hydroxypropoxy]-5-nitrophenyl]-
  • 1-[2-[3-[(1,1-Dimethylethyl)amino]-2-hydroxypropoxy]-5-nitrophenyl]ethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.