CymitQuimica logo

CAS 329763-32-8

:

Carbamic acid,(5-amino-2-methylphenyl)-, 1,1-dimethylethyl ester (9CI)

Description:
Carbamic acid, (5-amino-2-methylphenyl)-, 1,1-dimethylethyl ester, also known by its CAS number 329763-32-8, is an organic compound characterized by its carbamate functional group. This substance features a 5-amino-2-methylphenyl moiety, which contributes to its aromatic properties and potential biological activity. The presence of the 1,1-dimethylethyl ester group indicates that it has a bulky substituent, which can influence its solubility and reactivity. Typically, carbamates are known for their applications in agriculture as pesticides and herbicides, as well as in pharmaceuticals due to their ability to interact with biological systems. The compound may exhibit specific characteristics such as moderate to high stability under standard conditions, but its reactivity can vary based on environmental factors. Additionally, the presence of the amino group suggests potential for hydrogen bonding, which may affect its solubility in polar solvents. Overall, this compound's unique structure may lead to diverse applications in various fields, including medicinal chemistry and agrochemicals.
Formula:C12H18N2O2
InChI:InChI=1S/C12H18N2O2/c1-8-5-6-9(13)7-10(8)14-11(15)16-12(2,3)4/h5-7H,13H2,1-4H3,(H,14,15)
InChI key:DLOHVUPBQBCZGE-UHFFFAOYSA-N
SMILES:CC1=C(C=C(C=C1)N)NC(=O)OC(C)(C)C
Synonyms:
  • (5-Amino-2-Methyl-Phenyl)-Carbamic Acid Tert-Butyl Ester
Found 5 products.