CymitQuimica logo

CAS 329778-95-2

:

4-Bromo-2-[[(3-fluoro-4-methylphenyl)amino]methyl]-6-methoxyphenol

Description:
4-Bromo-2-[[(3-fluoro-4-methylphenyl)amino]methyl]-6-methoxyphenol, with the CAS number 329778-95-2, is a chemical compound characterized by its complex structure, which includes a bromine atom, a methoxy group, and an amino group attached to a phenolic framework. This compound features a fluorinated aromatic ring, contributing to its unique electronic properties and potential biological activity. The presence of the methoxy group enhances its solubility in organic solvents, while the bromine and fluorine substituents can influence its reactivity and interaction with biological targets. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. The molecular structure suggests that it may exhibit interesting pharmacological properties, possibly acting as an inhibitor or modulator in various biochemical processes. As with many organic compounds, its stability, reactivity, and biological activity would depend on environmental conditions and the presence of other chemical species.
Formula:C15H15BrFNO2
InChI:InChI=1S/C15H15BrFNO2/c1-9-3-4-12(7-13(9)17)18-8-10-5-11(16)6-14(20-2)15(10)19/h3-7,18-19H,8H2,1-2H3
InChI key:InChIKey=QVBADAXVAYOBBJ-UHFFFAOYSA-N
SMILES:C(NC1=CC(F)=C(C)C=C1)C2=C(O)C(OC)=CC(Br)=C2
Synonyms:
  • 4-Bromo-2-[[(3-fluoro-4-methylphenyl)amino]methyl]-6-methoxyphenol
  • Phenol, 4-bromo-2-[[(3-fluoro-4-methylphenyl)amino]methyl]-6-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.