CAS 329794-46-9

1,1-Dimethylethyl 4-[(2-chloro-4-pyridinyl)carbonyl]-1-piperazinecarboxylate

Description:

1,1-Dimethylethyl 4-[(2-chloro-4-pyridinyl)carbonyl]-1-piperazinecarboxylate, with the CAS number 329794-46-9, is a chemical compound characterized by its complex structure, which includes a piperazine ring and a pyridine moiety. This compound typically exhibits properties associated with both piperazine derivatives and pyridine-based compounds, such as potential biological activity and solubility in organic solvents. The presence of the dimethyl group contributes to its steric bulk, which can influence its interaction with biological targets. The chloro substituent on the pyridine ring may enhance its reactivity and binding affinity in pharmacological contexts. As a carboxylate ester, it may also exhibit stability under certain conditions while being susceptible to hydrolysis. Overall, this compound is of interest in medicinal chemistry and drug development, particularly for its potential therapeutic applications. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₁₅H₂₀ClN₃O₃

InChI: InChI=1S/C15H20ClN3O3/c1-15(2,3)22-14(21)19-8-6-18(7-9-19)13(20)11-4-5-17-12(16)10-11/h4-5,10H,6-9H2,1-3H3

InChI key: InChIKey=GBCJAYPOHWRWLJ-UHFFFAOYSA-N

SMILES: C(=O)(N1CCN(C(OC(C)(C)C)=O)CC1)C=2C=C(Cl)N=CC2

Synonyms:

• 1,1-Dimethylethyl 4-[(2-chloro-4-pyridinyl)carbonyl]-1-piperazinecarboxylate
• 1-Piperazinecarboxylic acid, 4-[(2-chloro-4-pyridinyl)carbonyl]-, 1,1-dimethylethyl ester

tert-Butyl 4-(2-chloroisonicotinoyl)tetrahydro-1(2H)-pyrazinecarboxylate

CAS: 329794-46-9

tert-Butyl 4-(2-chloroisonicotinoyl)tetrahydro-1(2H)-pyrazinecarboxylate

Purity: ≥95%

Molecular weight: 325.79g/mol

Ref: 54-OR21038