
CAS 329944-59-4
:(3-Bromo-5-chlorophenyl)(5-chloro-2-methoxyphenyl)methanone
Description:
(3-Bromo-5-chlorophenyl)(5-chloro-2-methoxyphenyl)methanone, with the CAS number 329944-59-4, is an organic compound characterized by its complex aromatic structure. It features a ketone functional group, which is indicative of its reactivity and potential applications in organic synthesis. The presence of bromine and chlorine substituents on the phenyl rings contributes to its unique electronic properties, potentially enhancing its reactivity in electrophilic aromatic substitution reactions. The methoxy group introduces additional steric and electronic effects, influencing the compound's solubility and interaction with biological systems. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its synthesis and characterization would typically involve standard organic reactions, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its structure and purity. Overall, this compound represents a valuable structure for exploration in various chemical and pharmaceutical applications.
Formula:C14H9BrCl2O2
InChI:InChI=1S/C14H9BrCl2O2/c1-19-13-3-2-10(16)7-12(13)14(18)8-4-9(15)6-11(17)5-8/h2-7H,1H3
InChI key:InChIKey=WKDWGUVVWBKJIT-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(OC)C=CC(Cl)=C1)C2=CC(Br)=CC(Cl)=C2
Synonyms:- (3-Bromo-5-chlorophenyl)(5-chloro-2-methoxyphenyl)methanone
- Methanone, (3-bromo-5-chlorophenyl)(5-chloro-2-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(3-Bromo-5-chlorophenyl)(5-chloro-2-methoxyphenyl)methanone
CAS:Formula:C14H9BrCl2O2Molecular weight:360.0301
