CymitQuimica logo

CAS 32998-25-7

:

2-chloro-3-methoxyquinoxaline

Description:
2-Chloro-3-methoxyquinoxaline is a heterocyclic compound characterized by its quinoxaline backbone, which consists of two fused aromatic rings containing nitrogen atoms. This compound features a chlorine atom at the 2-position and a methoxy group (-OCH3) at the 3-position of the quinoxaline structure. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the chlorine and methoxy substituents can influence its chemical reactivity and biological activity, making it of interest in medicinal chemistry and pharmacology. Compounds like 2-chloro-3-methoxyquinoxaline are often studied for their potential applications in drug development, particularly in the context of neuropharmacology and as potential inhibitors of specific biological targets. Its molecular structure contributes to its unique properties, including its ability to interact with various biological systems, which can be explored in research settings. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity.
Formula:C9H7ClN2O
InChI:InChI=1/C9H7ClN2O/c1-13-9-8(10)11-6-4-2-3-5-7(6)12-9/h2-5H,1H3
InChI key:TTXKLKHPMYZIAE-UHFFFAOYSA-N
SMILES:COc1c(Cl)nc2ccccc2n1
Synonyms:
  • Quinoxaline, 2-Chloro-3-Methoxy-
Found 4 products.