CAS 32998-28-0

2,5-dichloro-1,3,4-thiadiazole

Description:

2,5-Dichloro-1,3,4-thiadiazole is a heterocyclic compound characterized by a five-membered ring containing two chlorine atoms and a thiadiazole moiety. This compound features a nitrogen-sulfur framework, which contributes to its unique chemical properties. It is typically a solid at room temperature and is known for its stability under various conditions. The presence of chlorine atoms enhances its reactivity, making it useful in various chemical syntheses and applications, particularly in the field of agrochemicals and pharmaceuticals. 2,5-Dichloro-1,3,4-thiadiazole exhibits moderate solubility in organic solvents, while its solubility in water is limited. The compound is often utilized as an intermediate in the synthesis of other chemical entities, including herbicides and fungicides. Additionally, it may exhibit biological activity, which is of interest in medicinal chemistry. As with many halogenated compounds, appropriate safety measures should be taken when handling it due to potential toxicity and environmental concerns.

Formula: C₂Cl₂N₂S

InChI: InChI=1/C2Cl2N2S/c3-1-5-6-2(4)7-1

SMILES: c1(Cl)nnc(Cl)s1

1,3,4-Thiadiazole, 2,5-dichloro-

CAS: 32998-28-0

Formula: C₂Cl₂N₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 155.0058

Ref: IN-DA00CLPX

2,5-Dichloro-1,3,4-thiadiazole

CAS: 32998-28-0

2,5-Dichloro-1,3,4-thiadiazole

Formula: C₂Cl₂N₂S

Purity: 95%

Color and Shape: light yellow solid

Molecular weight: 155.01g/mol

Ref: 54-OR480881

2,5-Dichloro-1,3,4-thiadiazole

CAS: 32998-28-0

Purity: 97%

Molecular weight: 155

Ref: 10-F772940

dichloro-1,3,4-thiadiazole

CAS: 32998-28-0

Dichloro-1,3,4-thiadiazole is a dipole molecule with a nitrogen atom in the center of two chlorine atoms. It has a molecular electrostatic potential of -0.6 and an efficiency of 73%. Dichloro-1,3,4-thiadiazole is a polar molecule that can be described by three geometries: amide, dimethylformamide, and chlorine. The geometry of dichloro-1,3,4-thiadiazole is optimized using parameters such as the distance between two chlorine atoms (-2.8) and the distance between two nitrogen atoms (1.7).

Formula: C₂Cl₂N₂S

Purity: Min. 95%

Molecular weight: 155 g/mol

Ref: 3D-HBA99828