CAS 3300-25-2
:1-Hydroxy-8-methoxy-3-methyl-9,10-anthracenedione
Description:
1-Hydroxy-8-methoxy-3-methyl-9,10-anthracenedione, also known as "rubiadin," is an organic compound belonging to the anthraquinone family. It features a polycyclic aromatic structure with hydroxyl, methoxy, and methyl substituents, which contribute to its chemical properties and biological activities. This compound is characterized by its bright orange to red color, typical of many anthraquinones, and exhibits strong UV-Vis absorbance due to its conjugated system. It is soluble in organic solvents like ethanol and acetone but has limited solubility in water. Rubiadin has garnered interest for its potential applications in dyeing, as well as its pharmacological properties, including antioxidant and antimicrobial activities. The presence of hydroxyl and methoxy groups enhances its reactivity and interaction with biological systems. As with many anthraquinones, it may also exhibit fluorescence, making it useful in various analytical applications. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and environmental impact.
Formula:C16H12O4
InChI:InChI=1S/C16H12O4/c1-8-6-10-13(11(17)7-8)16(19)14-9(15(10)18)4-3-5-12(14)20-2/h3-7,17H,1-2H3
InChI key:InChIKey=HOGWLZYYLVDAOW-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)C=3C1=C(O)C=C(C)C3)=CC=CC2OC
Synonyms:- 1-Hydroxy-8-methoxy-3-methyl-9,10-anthracenedione
- 8-O-Methylchrysophanol
- Anthraquinone, 1-hydroxy-8-methoxy-3-methyl-
- Chrysophanol 8-methyl ether
- 9,10-Anthracenedione, 1-hydroxy-8-methoxy-3-methyl-
- 8-Methyl Chrysophanol
- 8-Methoxylchrysophanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
8-Methyl Chrysophanol
CAS:8-Methyl Chrysophanol (Chrysophanol 8-methyl ether) is an anthraquinone isolated from Eremurus chinensis, with potential antimicrobial activity.Formula:C16H12O4Purity:98%Color and Shape:SolidMolecular weight:268.268-Methyl chrysophanol
CAS:8-Methyl chrysophanol is a naturally-derived anthraquinone compound, primarily sourced from certain plant species known for their secondary metabolites. This compound is a structural analog of chrysophanol, characterized by the addition of a methyl group, which potentially alters its biological activity. The mode of action of 8-Methyl chrysophanol is not fully elucidated, but it is believed to interact with various cellular pathways, possibly involving modulation of enzyme activity or alteration of gene expression related to oxidative stress and inflammation.
Formula:C16H12O4Purity:Min. 95%Molecular weight:268.26 g/mol



