CAS 3301-61-9

16β,17-Dihydroxy-ent-kauran-19-oic acid

Description:

16β,17-Dihydroxy-ent-kauran-19-oic acid, with the CAS number 3301-61-9, is a naturally occurring compound classified as a diterpenoid. This substance is characterized by its complex structure, which includes a kaurene backbone, featuring hydroxyl groups at the 16β and 17 positions, contributing to its reactivity and potential biological activity. The presence of the carboxylic acid functional group at the 19 position enhances its solubility in polar solvents and may influence its interaction with biological systems. This compound is often studied for its potential pharmacological properties, including anti-inflammatory and antitumor activities, which are of interest in medicinal chemistry. Its natural occurrence in various plant species suggests a role in plant defense mechanisms and ecological interactions. The compound's stability, solubility, and reactivity can vary based on environmental conditions, making it a subject of interest in both synthetic and natural product chemistry. Overall, 16β,17-Dihydroxy-ent-kauran-19-oic acid exemplifies the diverse functionalities of terpenoids in biological systems.

Formula: C₂₀H₃₂O₄

InChI: InChI=1S/C20H32O4/c1-17-7-3-8-18(2,16(22)23)14(17)6-9-19-10-13(4-5-15(17)19)20(24,11-19)12-21/h13-15,21,24H,3-12H2,1-2H3,(H,22,23)/t13-,14+,15+,17-,18-,19+,20+/m1/s1

InChI key: InChIKey=MRBLTWPEPGRXQN-INIPNLRTSA-N

SMILES: C[C@]12[C@]3([C@@]4(C[C@@](CO)(O)[C@@](C4)(CC3)[H])CC[C@@]1([C@@](C(O)=O)(C)CCC2)[H])[H]

Synonyms:

• (-)-16,17-Dihydroxy-16β-kauran-19-oic acid
• Kauran-18-oic acid, 16,17-dihydroxy-, (4α)-
• Kauran-18-oic acid, 16,17-dihydroxy-
• (4α)-16,17-Dihydroxykauran-18-oic acid
• 16,17-Dihydroxy-16β-(-)-kauran-19-oic acid

ent-16β,17-Dihydroxy-19-kauraic acid

CAS: 3301-61-9

Formula: C₂₀H₃₂O₄

Purity: 98.0%

Molecular weight: 336.4657

Ref: IN-DA00CHU2

ent-16β,17-Dihydroxy-19-kauranoic acid

CAS: 3301-61-9

ent-16beta,17-Dihydroxy-19-kauranoic acid is a natural product for research related to life sciences.

Formula: C₂₀H₃₂O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 336.472

Ref: TM-TN3938

ent-16β,17-Dihydroxykauran-19-oic acid

CAS: 3301-61-9

Formula: C₂₀H₃₂O₄

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 336.472

Ref: BP-SBP00718

ent-16β,17-Dihydroxy-19-kauranoic acid

CAS: 3301-61-9

Ent-16β,17-Dihydroxy-19-kauranoic acid is a diterpenoid compound that can be classified as a naturally occurring plant metabolite. It is typically sourced from various medicinal plants, where it plays a role in the plants' biochemical pathways and defense mechanisms. The compound’s mode of action involves interacting with specific molecular targets, leading to a variety of biological effects, such as anti-inflammatory, antimicrobial, or cytotoxic activities, depending on the context and concentration.

Formula: C₂₀H₃₂O₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 336.5 g/mol

Ref: 3D-DAA30161