CAS 33012-73-6
:Cyanidin 3-sambubioside
Description:
Cyanidin 3-sambubioside is a naturally occurring anthocyanin, a type of flavonoid pigment responsible for the red, purple, and blue colors in many fruits and flowers. It is specifically a glycoside derivative of cyanidin, where the sugar moiety is sambubiose. This compound is known for its antioxidant properties, contributing to various health benefits, including anti-inflammatory and potential anti-cancer effects. Cyanidin 3-sambubioside is commonly found in berries, particularly elderberries, and is studied for its role in human health and nutrition. The compound exhibits solubility in water and is sensitive to pH changes, which can affect its color and stability. Its chemical structure allows it to interact with other molecules, making it significant in food science and pharmacology. Additionally, it is often used in the food industry as a natural colorant due to its vibrant hue. Overall, cyanidin 3-sambubioside is an important compound in both natural products and health-related research.
Formula:C26H29O15·Cl
InChI:InChI=1S/C26H28O15.ClH/c27-7-18-20(34)21(35)24(41-25-22(36)19(33)15(32)8-37-25)26(40-18)39-17-6-11-13(30)4-10(28)5-16(11)38-23(17)9-1-2-12(29)14(31)3-9;/h1-6,15,18-22,24-27,32-36H,7-8H2,(H3-,28,29,30,31);1H/t15-,18-,19+,20-,21+,22-,24-,25+,26-;/m1./s1
InChI key:InChIKey=BWHXEGJOYVNGQH-XOBUMVIESA-N
SMILES:O(C=1C(=[O+]C2=C(C1)C(O)=CC(O)=C2)C3=CC(O)=C(O)C=C3)[C@H]4[C@H](O[C@H]5[C@H](O)[C@@H](O)[C@H](O)CO5)[C@@H](O)[C@H](O)[C@@H](CO)O4.[Cl-]
Synonyms:- 1-Benzopyrylium, 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[(2-O-β-D-xylopyranosyl-β-D-glucopyranosyl)oxy]-, chloride (1:1)
- Sambicyanin
- Flavylium, 4′,5,5′,7-tetrahydroxy-3-[(2-O-β-D-xylopyranosyl-β-D-glucopyranosyl)oxy]-, chloride
- 1-Benzopyrylium, 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[(2-O-β-D-xylopyranosyl-β-D-glucopyranosyl)oxy]-, chloride
- Cyanidin 3-sambubioside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Cyanidin-3-O-sambubioside chloride
CAS:Cyanidin-3-O-sambubioside chloride analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C26H29O15ClPurity:(HPLC) ≥95%Color and Shape:PowderMolecular weight:616.96Cyanidin 3-sambubioside chloride
CAS:Cyanidin 3-sambubioside chloride (Cyanidin-3-O-sambubioside chloride) is a plant-derived anthocyanin that is an inhibitor of NO and H274Y mutations.Formula:C26H29ClO15Purity:97.6%Color and Shape:SolidMolecular weight:616.95Cyanidin 3-sambubioside chloride
CAS:Natural glycosideFormula:C26H29O15ClPurity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:616.96Cyanidin 3-Sambubioside
CAS:Controlled ProductFormula:C26H29O15·ClColor and Shape:NeatMolecular weight:616.95Cyanidin-3-O-sambubioside chloride
CAS:Cyanidin-3-O-sambubioside chloride is an anthocyanin compound, which is a type of naturally occurring flavonoid. It is sourced primarily from plant species, particularly those within the genera Sambucus (elderberries) and other pigmented fruits. This compound is characterized by its vivid coloration and is part of the larger class of water-soluble pigments responsible for the red, purple, and blue colors in many fruits and vegetables.
Formula:C26H29O15ClPurity:Min. 95%Color and Shape:PowderMolecular weight:616.95 g/mol






