CymitQuimica logo

CAS 33012-73-6

:

Cyanidin 3-sambubioside

Description:
Cyanidin 3-sambubioside is a naturally occurring anthocyanin, a type of flavonoid pigment responsible for the red, purple, and blue colors in many fruits and flowers. It is specifically a glycoside derivative of cyanidin, where the sugar moiety is sambubiose. This compound is known for its antioxidant properties, contributing to various health benefits, including anti-inflammatory and potential anti-cancer effects. Cyanidin 3-sambubioside is commonly found in berries, particularly elderberries, and is studied for its role in human health and nutrition. The compound exhibits solubility in water and is sensitive to pH changes, which can affect its color and stability. Its chemical structure allows it to interact with other molecules, making it significant in food science and pharmacology. Additionally, it is often used in the food industry as a natural colorant due to its vibrant hue. Overall, cyanidin 3-sambubioside is an important compound in both natural products and health-related research.
Formula:C26H29O15·Cl
InChI:InChI=1S/C26H28O15.ClH/c27-7-18-20(34)21(35)24(41-25-22(36)19(33)15(32)8-37-25)26(40-18)39-17-6-11-13(30)4-10(28)5-16(11)38-23(17)9-1-2-12(29)14(31)3-9;/h1-6,15,18-22,24-27,32-36H,7-8H2,(H3-,28,29,30,31);1H/t15-,18-,19+,20-,21+,22-,24-,25+,26-;/m1./s1
InChI key:InChIKey=BWHXEGJOYVNGQH-XOBUMVIESA-N
SMILES:O(C=1C(=[O+]C2=C(C1)C(O)=CC(O)=C2)C3=CC(O)=C(O)C=C3)[C@H]4[C@H](O[C@H]5[C@H](O)[C@@H](O)[C@H](O)CO5)[C@@H](O)[C@H](O)[C@@H](CO)O4.[Cl-]
Synonyms:
  • 1-Benzopyrylium, 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[(2-O-β-D-xylopyranosyl-β-D-glucopyranosyl)oxy]-, chloride (1:1)
  • Sambicyanin
  • Flavylium, 4′,5,5′,7-tetrahydroxy-3-[(2-O-β-D-xylopyranosyl-β-D-glucopyranosyl)oxy]-, chloride
  • 1-Benzopyrylium, 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[(2-O-β-D-xylopyranosyl-β-D-glucopyranosyl)oxy]-, chloride
  • Cyanidin 3-sambubioside
Found 11 products.