CAS 33018-78-9
:2-[chloro(difluoro)methoxy]-1,1,1-trifluoroethane
Description:
2-[Chloro(difluoro)methoxy]-1,1,1-trifluoroethane, with the CAS number 33018-78-9, is a fluorinated organic compound characterized by its unique structure that includes multiple fluorine and chlorine substituents. This compound typically exhibits properties associated with halogenated hydrocarbons, such as low volatility and high stability under standard conditions. Its molecular structure suggests that it may have applications in various fields, including as a solvent or in the formulation of specialty chemicals. The presence of fluorine atoms often imparts hydrophobic characteristics, making the compound less soluble in water but more soluble in organic solvents. Additionally, the chlorinated component may influence its reactivity and potential environmental impact. Safety considerations are essential when handling such compounds, as they may pose health risks or environmental concerns due to their persistence and potential for bioaccumulation. Overall, 2-[chloro(difluoro)methoxy]-1,1,1-trifluoroethane is a notable example of a fluorinated compound with specific chemical properties that warrant careful study and consideration in practical applications.
Formula:C3H2ClF5O
InChI:InChI=1/C3H2ClF5O/c4-3(8,9)10-1-2(5,6)7/h1H2
SMILES:C(C(F)(F)F)OC(Cl)(F)F
Synonyms:- 2-(Chlorodifluoromethoxy)-1,1,1-trifluoroethane
- Ethane, 2-(chlorodifluoromethoxy)-1,1,1-trifluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
2,2,2-Trifluoroethyl chlorodifluoromethyl ether
CAS:<p>2,2,2-Trifluoroethyl chlorodifluoromethyl ether</p>Molecular weight:184.4924g/molRef: 4Z-I-094004
Discontinued product



