CAS 33042-66-9

spiro[indene-1,4'-piperidine]

Description:

Spiro[indene-1,4'-piperidine] is a bicyclic compound characterized by its unique spiro structure, which consists of an indene moiety fused to a piperidine ring. This compound features a spiro carbon that connects the two rings, resulting in a three-dimensional arrangement that can influence its chemical reactivity and physical properties. The indene portion contributes to its aromatic characteristics, while the piperidine ring adds basicity due to the nitrogen atom. This compound is typically colorless to pale yellow and may exhibit moderate solubility in organic solvents. Its structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and aliphatic components that can interact with biological targets. Additionally, spiro compounds often exhibit interesting stereochemical properties, which can be leveraged in drug design to enhance selectivity and efficacy. Overall, spiro[indene-1,4'-piperidine] represents a fascinating example of how structural features can influence the behavior and utility of chemical substances.

Formula: C₁₃H₁₅N

InChI: InChI=1/C13H15N/c1-2-4-12-11(3-1)5-6-13(12)7-9-14-10-8-13/h1-6,14H,7-10H2

SMILES: c1ccc2c(c1)C=CC12CCNCC1

Synonyms:

• spiro[1H-indene-1,4'-piperidine]
• Spiro[inden-1,4'-piperidin]
• EOS-62210
• SPIRO[INDENE-1,4'-PIPERIDINE]

Spiro[indene-1,4'-piperidine]

CAS: 33042-66-9

Formula: C₁₃H₁₅N

Purity: 98%

Color and Shape: Liquid

Molecular weight: 185.2649

Ref: IN-DA00CADM

Spiro[indene-1,4'-piperidine]

CAS: 33042-66-9

Spiro[indene-1,4'-piperidine]

Purity: 98%

Molecular weight: 185.27g/mol

Ref: 54-OR90774

Spiro[indene-1,4′-piperidine]

CAS: 33042-66-9

Formula: C₁₃H₁₅N

Purity: 98%

Molecular weight: 185.27

Ref: 10-F216980