CAS 33050-36-1

3-Chloro-1,2,4-triazolo[4,3-b]pyridazine

Description:

3-Chloro-1,2,4-triazolo[4,3-b]pyridazine is a heterocyclic compound characterized by its unique triazole and pyridazine ring structures. This compound features a chlorine atom at the 3-position of the triazole ring, which can influence its reactivity and biological activity. It is typically a crystalline solid, exhibiting moderate solubility in polar solvents. The presence of both nitrogen and chlorine atoms in its structure contributes to its potential applications in pharmaceuticals and agrochemicals, as these elements can enhance biological activity and interaction with various biological targets. The compound may also exhibit interesting electronic properties due to the conjugated system formed by the triazole and pyridazine rings. Its synthesis often involves multi-step reactions, and it may be studied for its potential as a building block in drug development or as a ligand in coordination chemistry. Safety and handling precautions should be observed, as with many nitrogen-containing heterocycles, due to potential toxicity or reactivity.

Formula: C₅H₃ClN₄

InChI: InChI=1S/C5H3ClN4/c6-5-9-8-4-2-1-3-7-10(4)5/h1-3H

InChI key: InChIKey=GPWWYWGHZHRRCW-UHFFFAOYSA-N

SMILES: ClC=1N2C(C=CC=N2)=NN1

Synonyms:

• s-Triazolo[4,3-b]pyridazine, 3-chloro-
• 3-Chloro-1,2,4-triazolo[4,3-b]pyridazine
• 1,2,4-Triazolo[4,3-b]pyridazine, 3-chloro-

3-Chloro-[1,2,4]triazolo[4,3-b]pyridazine

CAS: 33050-36-1

Versatile small molecule scaffold

Formula: C₅H₃ClN₄

Purity: Min. 95%

Molecular weight: 154.56 g/mol

Ref: 3D-IBA05036