CAS 3306-52-3
:Viridin
Description:
Viridin, with the CAS number 3306-52-3, is a naturally occurring compound classified as a secondary metabolite. It is primarily derived from certain species of fungi, particularly those in the genus Penicillium. Viridin is known for its distinctive green color, which is attributed to its unique chemical structure. This compound exhibits a range of biological activities, including antifungal and antibacterial properties, making it of interest in pharmaceutical research. Its structure features a complex arrangement of carbon, hydrogen, and oxygen atoms, contributing to its reactivity and interaction with biological systems. Viridin's solubility characteristics can vary, influencing its bioavailability and potential applications in medicinal chemistry. Additionally, ongoing studies are exploring its role in plant-fungal interactions and its potential as a natural pesticide. Overall, viridin represents a fascinating area of study within natural products chemistry, with implications for both ecological and therapeutic applications.
Formula:C20H16O6
InChI:InChI=1S/C20H16O6/c1-20-11-5-3-8-9(4-6-12(8)21)13(11)16(23)17-14(20)10(7-26-17)15(22)18(25-2)19(20)24/h3,5,7,18-19,24H,4,6H2,1-2H3/t18-,19-,20-/m1/s1
InChI key:InChIKey=YEIGUXGHHKAURB-VAMGGRTRSA-N
SMILES:C[C@]12C3=C(C(=O)C=4C1=CC=C5C4CCC5=O)OC=C3C(=O)[C@@H](OC)[C@H]2O
Synonyms:- Viridin
- (1β,2β)-1-Hydroxy-2-methoxy-18-norandrosta-5,8,11,13-tetraeno[6,5,4-bc]furan-3,7,17-trione
- 18-Norandrosta-5,8,11,13-tetraeno[6,5,4-bc]furan-3,7,17-trione, 1-hydroxy-2-methoxy-, (1β,2β)-
- Viridine
- 18-Norandrosta-5,8,11,13-tetraeno[6,5,4-bc]furan-3,7,17-trione, 1β-hydroxy-2β-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
