CAS 3306-69-2

2-azabicyclo[2.2.2]octan-3-one

Description:

2-Azabicyclo[2.2.2]octan-3-one, also known as quinuclidinone, is a bicyclic organic compound characterized by its unique bicyclic structure that includes a nitrogen atom within a six-membered ring. This compound features a ketone functional group at the 3-position, contributing to its reactivity and potential applications in organic synthesis. It is a colorless to pale yellow liquid with a distinctive odor and is soluble in polar organic solvents. The presence of the nitrogen atom imparts basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and cyclizations. Quinuclidinone is of interest in medicinal chemistry due to its structural similarity to certain neurotransmitters and its potential use in the development of pharmaceuticals, particularly in the treatment of neurological disorders. Additionally, it serves as a building block in the synthesis of more complex molecules. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.

Formula: C₇H₁₁NO

InChI: InChI=1/C7H11NO/c9-7-5-1-3-6(8-7)4-2-5/h5-6H,1-4H2,(H,8,9)

SMILES: C1CC2CCC1C(=N2)O

2-Azabicyclo[2.2.2]octan-3-one

CAS: 3306-69-2

Formula: C₇H₁₁NO

Purity: 97%

Color and Shape: Solid

Molecular weight: 125.1683

Ref: IN-DA00C7WN

2-Azabicyclo[2.2.2]octan-3-one

CAS: 3306-69-2

2-Azabicyclo[2.2.2]octan-3-one

Purity: 97%

Molecular weight: 125.17g/mol

Ref: 54-OR94491

2-Azabicyclo[2.2.2]octan-3-one

CAS: 3306-69-2

Formula: C₇H₁₁NO

Purity: 97%

Color and Shape: Solid

Molecular weight: 125.171

Ref: 10-F222810

2-Azabicyclo[2.2.2]octan-3-one

Controlled Product

CAS: 3306-69-2

Applications 2-Azabicyclo[2.2.2]octan-3-one (cas# 3306-69-2) is a useful research chemical.

Formula: C₇H₁₁NO

Color and Shape: Neat

Molecular weight: 125.17

Ref: TR-A965798

2-Azabicyclo[2.2.2]octan-3-one

CAS: 3306-69-2

2-Azabicyclo[2.2.2]octan-3-one is a cyclic molecule that has a protonated form and a deprotonated form. The protonation of the ring nitrogen atom leads to conformational changes in the molecule, which are observed as changes in the magnetic properties of 2-azabicyclo[2.2.2]octan-3-one. These changes occur in the frequency range from 1 to 10 GHz, with a constant that depends on the solvent used for measurements (acetonitrile) and on the dilution factor of 2-azabicyclo[2.2.2]octan-3-one

Formula: C₇H₁₁NO

Purity: Min. 95%

Molecular weight: 125.17 g/mol

Ref: 3D-DAA30669