CAS 330638-41-0

2-({[5-(methoxymethyl)furan-2-yl]carbonyl}amino)benzoic acid

Description:

2-({[5-(methoxymethyl)furan-2-yl]carbonyl}amino)benzoic acid, with the CAS number 330638-41-0, is a chemical compound characterized by its complex structure that includes both furan and benzoic acid moieties. This compound features a furan ring substituted with a methoxymethyl group, which contributes to its unique reactivity and potential biological activity. The presence of the carbonyl and amino functional groups indicates that it may participate in various chemical reactions, such as amide formation or nucleophilic attacks. The benzoic acid portion of the molecule suggests potential acidity, which could influence its solubility and interaction with biological systems. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its specific characteristics, such as melting point, solubility, and stability, would depend on the molecular interactions and the environment in which it is studied.

Formula: C₁₄H₁₃NO₅

InChI: InChI=1/C14H13NO5/c1-19-8-9-6-7-12(20-9)13(16)15-11-5-3-2-4-10(11)14(17)18/h2-7H,8H2,1H3,(H,15,16)(H,17,18)

SMILES: COCc1ccc(C(=O)Nc2ccccc2C(=O)O)o1

Synonyms:

• 2-{[5-(Methoxymethyl)-2-furoyl]amino}benzoic acid
• Benzoic acid, 2-[[[5-(methoxymethyl)-2-furanyl]carbonyl]amino]-

2-{[5-(methoxymethyl)-2-furoyl]amino}benzoic acid

CAS: 330638-41-0

Formula: C₁₄H₁₃NO₅

Purity: 95.0%

Molecular weight: 275.26

Ref: 10-F314758