CymitQuimica logo

CAS 330671-29-9

:

N-butyl-N-methylpyrrolidinium hexafluorophosphate

Description:
N-butyl-N-methylpyrrolidinium hexafluorophosphate is an ionic liquid characterized by its unique combination of a pyrrolidinium cation and a hexafluorophosphate anion. The cation, N-butyl-N-methylpyrrolidinium, features a five-membered ring structure that enhances its thermal stability and solubility properties. This ionic liquid exhibits low volatility, making it an environmentally friendly alternative to traditional organic solvents. Its hexafluorophosphate anion contributes to its high ionic conductivity, which is beneficial for applications in electrochemistry and energy storage, such as in batteries and supercapacitors. Additionally, this substance is known for its wide liquid range and stability under various conditions, making it suitable for diverse applications in chemical synthesis, catalysis, and as a solvent in various chemical processes. Its properties, including low viscosity and high thermal stability, further enhance its utility in both industrial and research settings. Overall, N-butyl-N-methylpyrrolidinium hexafluorophosphate represents a versatile and promising compound in the field of green chemistry and materials science.
Formula:C9H20F6NP
InChI:InChI=1S/C9H20N.F6P/c1-3-4-7-10(2)8-5-6-9-10;1-7(2,3,4,5)6/h3-9H2,1-2H3;/q+1;-1
InChI key:HCGXEKKFZYYPFF-UHFFFAOYSA-N
SMILES:CCCC[N+]1(CCCC1)C.F[P-](F)(F)(F)(F)F
Found 6 products.