CAS 33070-04-1

(2R)-2,3-dihydro-1,4-benzodioxine-2-carboxamide

Description:

(2R)-2,3-Dihydro-1,4-benzodioxine-2-carboxamide is a chemical compound characterized by its unique bicyclic structure, which includes a benzodioxine moiety. This compound features a carboxamide functional group, contributing to its potential biological activity. The presence of the dioxine ring system imparts specific chemical properties, such as stability and reactivity under certain conditions. The stereochemistry indicated by the (2R) designation suggests that the compound has a specific three-dimensional arrangement, which can influence its interactions with biological targets. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its CAS number, 33070-04-1, serves as a unique identifier for regulatory and research purposes. Overall, the characteristics of this compound, including its molecular structure and functional groups, play a crucial role in determining its chemical behavior and potential applications in various fields, including pharmaceuticals and organic synthesis.

Formula: C₉H₉NO₃

InChI: InChI=1/C9H9NO3/c10-9(11)8-5-12-6-3-1-2-4-7(6)13-8/h1-4,8H,5H2,(H2,10,11)/t8-/m1/s1

SMILES: c1ccc2c(c1)OC[C@H](C(=N)O)O2

2,3-Dihydrobenzo[b][1,4]dioxine-2-carboxamide

CAS: 33070-04-1

2,3-Dihydrobenzo[b][1,4]dioxine-2-carboxamide

Purity: 97%

Molecular weight: 179.17g/mol

Ref: 54-OR75414

2,3-Dihydrobenzo[b][1,4]dioxine-2-carboxamide

CAS: 33070-04-1

Purity: 97%

Molecular weight: 179.1750031

Ref: 10-F618299

2,3-Dihydro-1,4-benzodioxine-2-carboxamide

CAS: 33070-04-1

2,3-Dihydro-1,4-benzodioxine-2-carboxamide is a dopamine receptor agonist that has been shown to bind to the 5-HT2A and D3 receptors. It has been used as an antipsychotic agent in the treatment of schizophrenia, bipolar disorder, and depression. The pharmacophore for this drug is based on the profile of dopamine D3 receptor agonists. The hybridization profiles of 2,3-dihydro-1,4-benzodioxine-2-carboxamide with 5HT2AR (5HT2A receptor) and 5HT2CR (5HT2C receptor) have been determined using NMR spectroscopy.

Formula: C₉H₉NO₃

Purity: Min. 95%

Molecular weight: 179.17 g/mol

Ref: 3D-IBA07004