CAS 33070-32-5
:5-bromo-2,2-difluorobenzodioxole
Description:
5-Bromo-2,2-difluorobenzodioxole is an organic compound characterized by its unique structure, which includes a benzodioxole moiety substituted with bromine and fluorine atoms. The presence of the bromine atom at the 5-position and two fluorine atoms at the 2,2-positions contributes to its chemical reactivity and physical properties. This compound is typically a colorless to pale yellow solid, exhibiting moderate solubility in organic solvents. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis due to the presence of halogen substituents, which can influence reactivity and biological activity. The compound's stability and reactivity can be affected by the electron-withdrawing nature of the fluorine atoms, which may enhance its electrophilic character. Additionally, the presence of the dioxole ring can impart unique electronic properties, making it of interest in materials science and medicinal chemistry. As with many halogenated compounds, safety precautions should be taken when handling due to potential toxicity and environmental impact.
Formula:C12H10FN
InChI:InChI=1/C12H10FN/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h1-9,14H
SMILES:c1ccc(cc1)Nc1ccc(cc1)F
Synonyms:- 4-Bromo-1,2-[(difluoromethylene)dioxy]benzene
- 3,4-[(Difluoromethylene)dioxy]bromobenzene
- 5-Bromo-2,2-Difluorobenzo[D][1,3]Dioxole
- 5-Bromo-2,2-Difluoro-1,3-Benzodioxole
- 4-fluoro-N-phenylaniline
- 5-bromo-2,2-difluoro-2H-1,3-benzodioxole
- 5-Bromo-2,2-difluoro-benz[1,3]dioxole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5-Bromo-2,2-difluoro-1,3-benzodioxole
CAS:Formula:C7H3BrF2O2Purity:>97.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:237.005-Bromo-2,2-difluoro-1,3-benzodioxole, 97%
CAS:<p>5-Bromo-2,2-difluoro-1,3- benzodioxole is used as a precursor in organic synthesis. It is used to prepare 5-bromo-2,2-difluoro-1,3-benzodioxole-4-carboxylic acid. It serves as an intermediate in active pharmaceutical ingredients, agrochemicals and in dyestuff field. This Thermo Scientific Chemicals </p>Formula:C7H3BrF2O2Purity:97%Color and Shape:Liquid, Clear colorlessMolecular weight:237.005-Bromo-2,2-difluorobenzodioxole
CAS:Formula:C7H3BrF2O2Purity:96%Color and Shape:LiquidMolecular weight:236.9983Ref: IN-DA003MGA
1g22.00€5g20.00€10g26.00€25g34.00€5kgTo inquire100g66.00€10kgTo inquire25kgTo inquire500g182.00€5-Bromo-2,2-difluoro-1,3-benzodioxole
CAS:5-Bromo-2,2-difluoro-1,3-benzodioxoleFormula:C7H3BrF2O2Purity:99%Color and Shape: colourless liquidMolecular weight:237.00g/mol5-Bromo-2,2-difluoro-1,3-benzodioxole
CAS:Formula:C7H3BrF2O2Purity:96%Color and Shape:LiquidMolecular weight:2375-Bromo-2,2-difluoro-1,3-benzodioxole
CAS:5-Bromo-2,2-difluoro-1,3-benzodioxole is an industrial chemical that can be used in the production of cuprous cyanide. It is made by reacting methanol with hydrogen fluoride and catalysts. The product yield is high and the reaction process is efficient. 5-Bromo-2,2-difluoro-1,3-benzodioxole can be used to produce 1-4c alkyl cyanides by esterification. The catalyst for this reaction is typically a fluoride salt or a metallic salt such as zinc chloride or ferric chloride. This chemical can also be used to produce cyanide from hydrogen cyanide or hydrocyanic acid. The large scale process flow for this chemical involves use of a catalyst, such as sodium hydroxide, potassium hydroxide, or calcium oxide.Formula:C7H3BrF2O2Purity:Min. 95%Molecular weight:237 g/mol





