CymitQuimica logo

CAS 330786-34-0

:

5-Pyrimidinecarboxylic acid,4-[[(3-chloro-4-methoxyphenyl)methyl]amino]-2-(methylthio)-

Description:
5-Pyrimidinecarboxylic acid, 4-[[(3-chloro-4-methoxyphenyl)methyl]amino]-2-(methylthio)-, identified by CAS number 330786-34-0, is a chemical compound characterized by its pyrimidine core structure, which is a six-membered heterocyclic ring containing nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidity and potential for forming salts or esters. The presence of a chloro group and a methoxy group on the phenyl ring enhances its reactivity and solubility in organic solvents. Additionally, the methylthio group introduces sulfur into the structure, which can influence the compound's biological activity and interactions. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental conditions such as pH and temperature.
Formula:C14H14ClN3O3S
InChI:InChI=1S/C14H14ClN3O3S/c1-21-11-4-3-8(5-10(11)15)6-16-12-9(13(19)20)7-17-14(18-12)22-2/h3-5,7H,6H2,1-2H3,(H,19,20)(H,16,17,18)
InChI key:PXYYGISXAWKTCT-UHFFFAOYSA-N
SMILES:COC1=C(C=C(C=C1)CNC2=NC(=NC=C2C(=O)O)SC)Cl
Synonyms:
  • 4-((3-Chloro-4-methoxybenzyl)amino)-2-(methylthio)pyrimidine-5-carboxylic acid
  • 4-[(3-chloro-4-methoxybenzyl)amino]-2-(methylsulfanyl)pyrimidine-5-carboxylic acid
Found 6 products.