CAS 330793-63-0
:4-bromo-N-(1-phenylethyl)aniline
Description:
4-Bromo-N-(1-phenylethyl)aniline is an organic compound characterized by its structure, which includes a bromine atom, an aniline group, and a phenylethyl substituent. This compound features a bromine atom attached to the para position of the aniline ring, which can influence its reactivity and physical properties. The presence of the phenylethyl group contributes to its hydrophobic characteristics, potentially affecting its solubility in various solvents. Typically, compounds like this may exhibit moderate to high melting and boiling points due to the presence of strong intermolecular forces, such as dipole-dipole interactions and van der Waals forces. Additionally, the bromine substituent can enhance the compound's reactivity in electrophilic aromatic substitution reactions. 4-Bromo-N-(1-phenylethyl)aniline may also have applications in organic synthesis, pharmaceuticals, or as an intermediate in the production of other chemical compounds. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks.
Formula:C14H14BrN
InChI:InChI=1/C14H14BrN/c1-11(12-5-3-2-4-6-12)16-14-9-7-13(15)8-10-14/h2-11,16H,1H3
SMILES:CC(c1ccccc1)Nc1ccc(cc1)Br
Synonyms:- 4-Brom-N-(1-phenylethyl)anilin
- benzenemethanamine, N-(4-bromophenyl)-α-methyl-
- 4-Bromo-N-(1-phenylethyl)aniline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Bromo-N-(1-phenylethyl)aniline hydrochloride
CAS:<p>4-Bromo-N-(1-phenylethyl)aniline hydrochloride</p>Molecular weight:312.63g/mol
